### Eclipse Workspace Patch 1.0
#P org.eclipse.jdt.ui.tests
Index: META-INF/MANIFEST.MF
===================================================================
RCS file: /cvsroot/eclipse/org.eclipse.jdt.ui.tests/META-INF/MANIFEST.MF,v
retrieving revision 1.4
diff -u -r1.4 MANIFEST.MF
--- META-INF/MANIFEST.MF 27 Sep 2007 09:32:38 -0000 1.4
+++ META-INF/MANIFEST.MF 4 Oct 2007 13:50:08 -0000
@@ -25,6 +25,7 @@
org.eclipse.jdt.ui.tests.core;x-internal:=true,
org.eclipse.jdt.ui.tests.core.source;x-internal:=true,
org.eclipse.jdt.ui.tests.dialogs;x-internal:=true,
+ org.eclipse.jdt.ui.tests.jarexport;x-internal:=true,
org.eclipse.jdt.ui.tests.leaks;x-internal:=true,
org.eclipse.jdt.ui.tests.model;x-internal:=true,
org.eclipse.jdt.ui.tests.packageview;x-internal:=true,
Index: test plugin/org/eclipse/jdt/testplugin/JavaProjectHelper.java
===================================================================
RCS file: /cvsroot/eclipse/org.eclipse.jdt.ui.tests/test plugin/org/eclipse/jdt/testplugin/JavaProjectHelper.java,v
retrieving revision 1.50
diff -u -r1.50 JavaProjectHelper.java
--- test plugin/org/eclipse/jdt/testplugin/JavaProjectHelper.java 29 May 2007 18:18:29 -0000 1.50
+++ test plugin/org/eclipse/jdt/testplugin/JavaProjectHelper.java 4 Oct 2007 13:50:08 -0000
@@ -339,6 +339,20 @@
* @throws CoreException Creation failed
*/
public static IPackageFragmentRoot addSourceContainer(IJavaProject jproject, String containerName, IPath[] inclusionFilters, IPath[] exclusionFilters) throws CoreException {
+ return addSourceContainer(jproject, containerName, inclusionFilters, exclusionFilters, null);
+ }
+
+ /**
+ * Adds a source container to a IJavaProject.
+ * @param jproject The parent project
+ * @param containerName The name of the new source container
+ * @param inclusionFilters Inclusion filters to set
+ * @param exclusionFilters Exclusion filters to set
+ * @param outputLocation The location where class files are written to, null for project output folder
+ * @return The handle to the new source container
+ * @throws CoreException Creation failed
+ */
+ public static IPackageFragmentRoot addSourceContainer(IJavaProject jproject, String containerName, IPath[] inclusionFilters, IPath[] exclusionFilters, String outputLocation) throws CoreException {
IProject project= jproject.getProject();
IContainer container= null;
if (containerName == null || containerName.length() == 0) {
@@ -352,7 +366,15 @@
}
IPackageFragmentRoot root= jproject.getPackageFragmentRoot(container);
- IClasspathEntry cpe= JavaCore.newSourceEntry(root.getPath(), inclusionFilters, exclusionFilters, null);
+ IPath outputPath= null;
+ if (outputLocation != null) {
+ IFolder folder= project.getFolder(outputLocation);
+ if (!folder.exists()) {
+ CoreUtility.createFolder(folder, false, true, null);
+ }
+ outputPath= folder.getFullPath();
+ }
+ IClasspathEntry cpe= JavaCore.newSourceEntry(root.getPath(), inclusionFilters, exclusionFilters, outputPath);
addToClasspath(jproject, cpe);
return root;
}
Index: ui/org/eclipse/jdt/ui/tests/AutomatedSuite.java
===================================================================
RCS file: /cvsroot/eclipse/org.eclipse.jdt.ui.tests/ui/org/eclipse/jdt/ui/tests/AutomatedSuite.java,v
retrieving revision 1.50
diff -u -r1.50 AutomatedSuite.java
--- ui/org/eclipse/jdt/ui/tests/AutomatedSuite.java 6 Aug 2007 13:55:58 -0000 1.50
+++ ui/org/eclipse/jdt/ui/tests/AutomatedSuite.java 4 Oct 2007 13:50:08 -0000
@@ -1,5 +1,5 @@
/*******************************************************************************
- * Copyright (c) 2000, 2006 IBM Corporation and others.
+ * Copyright (c) 2000, 2007 IBM Corporation and others.
* All rights reserved. This program and the accompanying materials
* are made available under the terms of the Eclipse Public License v1.0
* which accompanies this distribution, and is available at
@@ -21,6 +21,7 @@
import org.eclipse.jdt.ui.tests.buildpath.BuildpathModifierActionTest;
import org.eclipse.jdt.ui.tests.callhierarchy.CallHierarchyContentProviderTest;
import org.eclipse.jdt.ui.tests.core.CoreTests;
+import org.eclipse.jdt.ui.tests.jarexport.JarExportTests;
import org.eclipse.jdt.ui.tests.packageview.PackageExplorerTests;
import org.eclipse.jdt.ui.tests.quickfix.QuickFixTest;
import org.eclipse.jdt.ui.tests.search.SearchTest;
@@ -67,6 +68,8 @@
addTest(JUnitJUnitTests.suite());
addTest(BuildpathModifierActionTest.suite());
+
+ addTest(JarExportTests.suite());
}
}
Index: ui/org/eclipse/jdt/ui/tests/jarexport/JarExportTests.java
===================================================================
RCS file: ui/org/eclipse/jdt/ui/tests/jarexport/JarExportTests.java
diff -N ui/org/eclipse/jdt/ui/tests/jarexport/JarExportTests.java
--- /dev/null 1 Jan 1970 00:00:00 -0000
+++ ui/org/eclipse/jdt/ui/tests/jarexport/JarExportTests.java 1 Jan 1970 00:00:00 -0000
@@ -0,0 +1,25 @@
+/*******************************************************************************
+ * Copyright (c) 2007 IBM Corporation and others.
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Eclipse Public License v1.0
+ * which accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * IBM Corporation - initial API and implementation
+ *******************************************************************************/
+package org.eclipse.jdt.ui.tests.jarexport;
+
+import junit.framework.Test;
+import junit.framework.TestSuite;
+
+public class JarExportTests {
+
+ public static Test suite() {
+ TestSuite suite= new TestSuite("Test for org.eclipse.jdt.ui.tests.jarexport");
+ //$JUnit-BEGIN$
+ suite.addTest(FatJarExportTests.allTests());
+ //$JUnit-END$
+ return suite;
+ }
+}
Index: ui/org/eclipse/jdt/ui/tests/jarexport/FatJarExportTests.java
===================================================================
RCS file: ui/org/eclipse/jdt/ui/tests/jarexport/FatJarExportTests.java
diff -N ui/org/eclipse/jdt/ui/tests/jarexport/FatJarExportTests.java
--- /dev/null 1 Jan 1970 00:00:00 -0000
+++ ui/org/eclipse/jdt/ui/tests/jarexport/FatJarExportTests.java 1 Jan 1970 00:00:00 -0000
@@ -0,0 +1,311 @@
+/*******************************************************************************
+ * Copyright (c) 2007 IBM Corporation and others.
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Eclipse Public License v1.0
+ * which accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * IBM Corporation - initial API and implementation
+ *******************************************************************************/
+package org.eclipse.jdt.ui.tests.jarexport;
+
+import java.io.File;
+import java.util.zip.ZipFile;
+
+import junit.framework.Test;
+import junit.framework.TestCase;
+import junit.framework.TestSuite;
+
+import org.eclipse.core.runtime.CoreException;
+import org.eclipse.core.runtime.IPath;
+import org.eclipse.core.runtime.IStatus;
+import org.eclipse.core.runtime.MultiStatus;
+import org.eclipse.core.runtime.Path;
+
+import org.eclipse.core.resources.IMarker;
+import org.eclipse.core.resources.IResource;
+import org.eclipse.core.resources.IncrementalProjectBuilder;
+import org.eclipse.core.resources.ResourcesPlugin;
+
+import org.eclipse.ui.IWorkbenchWindow;
+import org.eclipse.ui.PlatformUI;
+
+import org.eclipse.debug.core.DebugPlugin;
+import org.eclipse.debug.core.ILaunchConfiguration;
+import org.eclipse.debug.core.ILaunchConfigurationType;
+import org.eclipse.debug.core.ILaunchConfigurationWorkingCopy;
+import org.eclipse.debug.core.ILaunchManager;
+
+import org.eclipse.jdt.core.IJavaProject;
+import org.eclipse.jdt.core.IPackageFragment;
+import org.eclipse.jdt.core.IPackageFragmentRoot;
+import org.eclipse.jdt.core.JavaCore;
+
+import org.eclipse.jdt.launching.IJavaLaunchConfigurationConstants;
+
+import org.eclipse.jdt.ui.JavaUI;
+import org.eclipse.jdt.ui.jarpackager.IJarExportRunnable;
+import org.eclipse.jdt.ui.jarpackager.JarPackageData;
+
+import org.eclipse.jdt.internal.ui.JavaPlugin;
+import org.eclipse.jdt.internal.ui.jarpackager.JarPackagerUtil;
+import org.eclipse.jdt.internal.ui.jarpackagerfat.FatJarBuilder;
+import org.eclipse.jdt.internal.ui.jarpackagerfat.FatJarPackageWizardPage;
+import org.eclipse.jdt.internal.ui.util.BusyIndicatorRunnableContext;
+
+import org.eclipse.jdt.testplugin.JavaProjectHelper;
+import org.eclipse.jdt.testplugin.JavaTestPlugin;
+
+import org.eclipse.jdt.ui.tests.core.ProjectTestSetup;
+
+public class FatJarExportTests extends TestCase {
+
+ private static final Class THIS= FatJarExportTests.class;
+
+ public static Test suite() {
+ return allTests();
+ }
+
+ public static Test allTests() {
+ return new ProjectTestSetup(new TestSuite(THIS));
+ }
+
+ private IJavaProject fProject;
+ private IPackageFragmentRoot fMainRoot;
+
+ /**
+ * {@inheritDoc}
+ */
+ protected void setUp() throws Exception {
+ fProject= ProjectTestSetup.getProject();
+
+ fMainRoot= JavaProjectHelper.addSourceContainer(fProject, "src");
+ IPackageFragment fragment= fMainRoot.createPackageFragment("org.eclipse.jdt.ui.test", true, null);
+ StringBuffer buf= new StringBuffer();
+ buf.append("package org.eclipse.jdt.ui.test;\n");
+ buf.append("import mylib.Foo;\n");
+ buf.append("public class Main {\n");
+ buf.append(" public static void main(String[] args) {\n");
+ buf.append(" new Foo();\n");
+ buf.append(" new Foo.FooInner();\n");
+ buf.append(" new Foo.FooInner.FooInnerInner();\n");
+ buf.append(" }\n");
+ buf.append("}\n");
+ fragment.createCompilationUnit("Main.java", buf.toString(), true, null);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected void tearDown() throws Exception {
+ JavaProjectHelper.clear(fProject, ProjectTestSetup.getDefaultClasspath());
+ }
+
+ private static String getFooContent() {
+ StringBuffer buf= new StringBuffer();
+ buf.append("package mylib;\n");
+ buf.append("public class Foo {\n");
+ buf.append(" public static class FooInner {\n");
+ buf.append(" public static class FooInnerInner {\n");
+ buf.append(" }\n");
+ buf.append(" }\n");
+ buf.append("}\n");
+ return buf.toString();
+ }
+
+ private static void assertFatJarExport(IJavaProject project, String archiveName) throws Exception {
+ //create class files
+ ResourcesPlugin.getWorkspace().build(IncrementalProjectBuilder.FULL_BUILD, null);
+
+ IMarker[] markers= ResourcesPlugin.getWorkspace().getRoot().findMarkers(null, true, IResource.DEPTH_INFINITE);
+ for (int i= 0; i < markers.length; i++) {
+ IMarker marker= markers[i];
+ if (marker.getAttribute(IMarker.SEVERITY, IMarker.SEVERITY_INFO) == IMarker.SEVERITY_ERROR) {
+ assertTrue((String) marker.getAttribute(IMarker.MESSAGE), false);
+ }
+ }
+
+ //create data
+ JarPackageData data= createJarPackageData(project, archiveName);
+
+ //create archive
+ ZipFile generatedArchive= createArchive(data);
+
+ //assert archive content as expected
+ assertNotNull(generatedArchive);
+ assertNotNull(generatedArchive.getEntry("org/eclipse/jdt/ui/test/Main.class"));
+ assertNotNull(generatedArchive.getEntry("mylib/Foo.class"));
+ assertNotNull(generatedArchive.getEntry("mylib/Foo$FooInner.class"));
+ assertNotNull(generatedArchive.getEntry("mylib/Foo$FooInner$FooInnerInner.class"));
+ }
+
+ private static JarPackageData createJarPackageData(IJavaProject project, String archiveName) throws CoreException {
+ JarPackageData data= new JarPackageData();
+ data.setJarBuilder(new FatJarBuilder());
+
+ IPath destination= ResourcesPlugin.getWorkspace().getRoot().getLocation().append(archiveName);
+ data.setJarLocation(destination);
+
+ ILaunchConfiguration launchConfig= createTempLaunchConfig(project);
+
+ MultiStatus status= new MultiStatus(JavaUI.ID_PLUGIN, 0, "", null);
+ Object[] children= FatJarPackageWizardPage.getSelectedElementsWithoutContainedChildren(launchConfig, data, new BusyIndicatorRunnableContext(), status);
+ assertTrue(getProblems(status), status.getSeverity() == IStatus.OK || status.getSeverity() == IStatus.INFO);
+ data.setElements(children);
+ return data;
+ }
+
+ private static String getProblems(MultiStatus status) {
+ StringBuffer result= new StringBuffer();
+
+ IStatus[] children= status.getChildren();
+ for (int i= 0; i < children.length; i++) {
+ result.append(children[i].getMessage()).append("\n");
+ }
+
+ return result.toString();
+ }
+
+ /*
+ * From org.eclipse.jdt.internal.debug.ui.launcher.JavaApplicationLaunchShortcut
+ *
+ * For internal use only (testing), clients must not call.
+ */
+ public static ILaunchConfiguration createTempLaunchConfig(IJavaProject project) {
+ String projectName= project.getElementName();
+
+ String configname= "fatjar_cfg_eraseme_" + projectName; //$NON-NLS-1$
+ ILaunchConfiguration config= null;
+ ILaunchConfigurationWorkingCopy wc= null;
+ try {
+ ILaunchManager launchManager= DebugPlugin.getDefault().getLaunchManager();
+ ILaunchConfigurationType configType= launchManager.getLaunchConfigurationType(IJavaLaunchConfigurationConstants.ID_JAVA_APPLICATION);
+ wc= configType.newInstance(null, launchManager.generateUniqueLaunchConfigurationNameFrom(configname));
+ } catch (CoreException e) {
+ JavaPlugin.log(e);
+ return null;
+ }
+
+ wc.setAttribute(IJavaLaunchConfigurationConstants.ATTR_MAIN_TYPE_NAME, "org.eclipse.jdt.ui.test.Main");
+ wc.setAttribute(IJavaLaunchConfigurationConstants.ATTR_PROJECT_NAME, projectName);
+ try {
+ config= wc.doSave();
+ } catch (CoreException e) {
+ JavaPlugin.log(e);
+ }
+
+ return config;
+ }
+
+ private static ZipFile createArchive(JarPackageData data) throws Exception, CoreException {
+ IWorkbenchWindow window= PlatformUI.getWorkbench().getActiveWorkbenchWindow();
+
+ IJarExportRunnable op= data.createJarExportRunnable(window.getShell());
+ window.run(false, false, op);
+
+ IStatus status= op.getStatus();
+ if (status.getSeverity() == IStatus.ERROR)
+ throw new CoreException(status);
+
+ return JarPackagerUtil.getArchiveFile(data.getJarLocation());
+ }
+
+ public void testExportSameSrcRoot() throws Exception {
+ IPackageFragment pack= fMainRoot.createPackageFragment("mylib", true, null);
+ try {
+ pack.createCompilationUnit("Foo.java", getFooContent(), true, null);
+
+ assertFatJarExport(fProject, getName() + ".jar");
+ } finally {
+ pack.delete(true, null);
+ }
+ }
+
+ public void testExportSrcRootWithOutputFolder() throws Exception {
+ IPackageFragmentRoot root= JavaProjectHelper.addSourceContainer(fProject, "other", new IPath[0], new IPath[0], "otherout");
+ try {
+ IPackageFragment pack= root.createPackageFragment("mylib", true, null);
+ pack.createCompilationUnit("Foo.java", getFooContent(), true, null);
+
+ assertFatJarExport(fProject, getName() + ".jar");
+ } finally {
+ JavaProjectHelper.removeSourceContainer(fProject, root.getElementName());
+ }
+ }
+
+ public void testExportOtherSrcRoot() throws Exception {
+ IPackageFragmentRoot root= JavaProjectHelper.addSourceContainer(fProject, "other");
+ try {
+ IPackageFragment pack= root.createPackageFragment("mylib", true, null);
+ pack.createCompilationUnit("Foo.java", getFooContent(), true, null);
+
+ assertFatJarExport(fProject, getName() + ".jar");
+ } finally {
+ JavaProjectHelper.removeSourceContainer(fProject, root.getElementName());
+ }
+ }
+
+ public void testExportOtherProject() throws Exception {
+ IJavaProject otherProject= JavaProjectHelper.createJavaProject("OtherProject", "bin");
+ try {
+ otherProject.setRawClasspath(ProjectTestSetup.getDefaultClasspath(), null);
+
+ IPackageFragmentRoot root= JavaProjectHelper.addSourceContainer(otherProject, "other");
+ IPackageFragment pack= root.createPackageFragment("mylib", true, null);
+ pack.createCompilationUnit("Foo.java", getFooContent(), true, null);
+
+ JavaProjectHelper.addRequiredProject(fProject, otherProject);
+
+ assertFatJarExport(fProject, getName() + ".jar");
+ } finally {
+ JavaProjectHelper.removeFromClasspath(fProject, otherProject.getProject().getFullPath());
+ JavaProjectHelper.delete(otherProject);
+ }
+ }
+
+ public void testExportInternalLib() throws Exception {
+ File lib= JavaTestPlugin.getDefault().getFileInPlugin(JavaProjectHelper.MYLIB);
+ IPackageFragmentRoot root= JavaProjectHelper.addLibraryWithImport(fProject, Path.fromOSString(lib.getPath()), null, null);
+
+ try {
+ assertFatJarExport(fProject, getName() + ".jar");
+ } finally {
+ JavaProjectHelper.removeFromClasspath(fProject, root.getPath());
+ }
+ }
+
+ public void testExportExternalLib() throws Exception {
+ File lib= JavaTestPlugin.getDefault().getFileInPlugin(JavaProjectHelper.MYLIB);
+ IPackageFragmentRoot root= JavaProjectHelper.addLibrary(fProject, Path.fromOSString(lib.getPath()));
+
+ try {
+ assertFatJarExport(fProject, getName() + ".jar");
+ } finally {
+ JavaProjectHelper.removeFromClasspath(fProject, root.getPath());
+ }
+ }
+
+ public void testClassFolder() throws Exception {
+ File lib= JavaTestPlugin.getDefault().getFileInPlugin(JavaProjectHelper.MYLIB);
+
+ IPackageFragmentRoot root= JavaProjectHelper.addClassFolderWithImport(fProject, "cf", null, null, lib);
+ try {
+ assertFatJarExport(fProject, getName() + ".jar");
+ } finally {
+ JavaProjectHelper.removeFromClasspath(fProject, root.getPath());
+ }
+ }
+
+ public void testVariable() throws Exception {
+ File lib= JavaTestPlugin.getDefault().getFileInPlugin(JavaProjectHelper.MYLIB);
+ JavaCore.setClasspathVariable("MYLIB", Path.fromOSString(lib.getPath()), null);
+
+ JavaProjectHelper.addVariableEntry(fProject, new Path("MYLIB"), null, null);
+ try {
+ assertFatJarExport(fProject, getName() + ".jar");
+ } finally {
+ JavaProjectHelper.removeFromClasspath(fProject, new Path("MYLIB"));
+ }
+ }
+}
#P org.eclipse.jdt.ui
Index: plugin.properties
===================================================================
RCS file: /cvsroot/eclipse/org.eclipse.jdt.ui/plugin.properties,v
retrieving revision 1.480
diff -u -r1.480 plugin.properties
--- plugin.properties 2 Oct 2007 12:14:14 -0000 1.480
+++ plugin.properties 4 Oct 2007 13:50:11 -0000
@@ -191,6 +191,8 @@
jarExportWizard.label=JAR file
jarExportWizard.description=Export resources into a JAR file on the local file system.
+fatJarExportWizard.label=Runnable JAR file
+fatJarExportWizard.description=Export all resources required to run an application into a JAR file on the local file system.
createJarAction.label=Create &JAR
createJarAction.tooltip=Creates the JAR Based on the Selected JAR Description File
Index: plugin.xml
===================================================================
RCS file: /cvsroot/eclipse/org.eclipse.jdt.ui/plugin.xml,v
retrieving revision 1.764
diff -u -r1.764 plugin.xml
--- plugin.xml 3 Oct 2007 17:07:13 -0000 1.764
+++ plugin.xml 4 Oct 2007 13:50:12 -0000
@@ -1917,6 +1917,19 @@
class="org.eclipse.core.resources.IResource">
+
Index: ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackageWizardPage.java
===================================================================
RCS file: /cvsroot/eclipse/org.eclipse.jdt.ui/ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackageWizardPage.java,v
retrieving revision 1.77
diff -u -r1.77 JarPackageWizardPage.java
--- ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackageWizardPage.java 29 May 2007 18:41:48 -0000 1.77
+++ ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackageWizardPage.java 4 Oct 2007 13:50:13 -0000
@@ -10,7 +10,6 @@
*******************************************************************************/
package org.eclipse.jdt.internal.ui.jarpackager;
-import java.io.File;
import java.lang.reflect.InvocationTargetException;
import java.util.HashSet;
import java.util.Iterator;
@@ -20,7 +19,6 @@
import org.eclipse.core.runtime.IPath;
import org.eclipse.core.runtime.IProgressMonitor;
import org.eclipse.core.runtime.IStatus;
-import org.eclipse.core.runtime.Path;
import org.eclipse.core.resources.IFile;
import org.eclipse.core.resources.IFolder;
@@ -36,10 +34,7 @@
import org.eclipse.swt.layout.GridData;
import org.eclipse.swt.layout.GridLayout;
import org.eclipse.swt.widgets.Button;
-import org.eclipse.swt.widgets.Combo;
import org.eclipse.swt.widgets.Composite;
-import org.eclipse.swt.widgets.Event;
-import org.eclipse.swt.widgets.FileDialog;
import org.eclipse.swt.widgets.Label;
import org.eclipse.swt.widgets.Link;
import org.eclipse.swt.widgets.TreeItem;
@@ -56,7 +51,6 @@
import org.eclipse.jface.wizard.IWizardPage;
import org.eclipse.ui.PlatformUI;
-import org.eclipse.ui.dialogs.WizardExportResourcesPage;
import org.eclipse.ltk.core.refactoring.RefactoringCore;
import org.eclipse.ltk.core.refactoring.history.IRefactoringHistoryService;
@@ -82,13 +76,12 @@
import org.eclipse.jdt.internal.ui.IJavaHelpContextIds;
import org.eclipse.jdt.internal.ui.filters.EmptyInnerPackageFilter;
import org.eclipse.jdt.internal.ui.util.ExceptionHandler;
-import org.eclipse.jdt.internal.ui.util.SWTUtil;
import org.eclipse.jdt.internal.ui.viewsupport.LibraryFilter;
/**
* Page 1 of the JAR Package wizard
*/
-class JarPackageWizardPage extends WizardExportResourcesPage implements IJarPackageWizardPage {
+class JarPackageWizardPage extends AbstractJarDestinationWizardPage {
private JarPackageData fJarPackage;
private IStructuredSelection fInitialSelection;
@@ -101,9 +94,6 @@
private Button fExportRefactoringsCheckbox;
private Link fRefactoringLink;
- private Combo fDestinationNamesCombo;
- private Button fDestinationBrowseButton;
-
private Button fCompressCheckbox;
private Button fOverwriteCheckbox;
private Button fIncludeDirectoryEntriesCheckbox;
@@ -116,8 +106,6 @@
private static final String STORE_EXPORT_OUTPUT_FOLDERS= PAGE_NAME + ".EXPORT_OUTPUT_FOLDER"; //$NON-NLS-1$
private static final String STORE_EXPORT_JAVA_FILES= PAGE_NAME + ".EXPORT_JAVA_FILES"; //$NON-NLS-1$
- private static final String STORE_DESTINATION_NAMES= PAGE_NAME + ".DESTINATION_NAMES_ID"; //$NON-NLS-1$
-
private static final String STORE_REFACTORINGS= PAGE_NAME + ".REFACTORINGS"; //$NON-NLS-1$
private static final String STORE_COMPRESS= PAGE_NAME + ".COMPRESS"; //$NON-NLS-1$
private final static String STORE_OVERWRITE= PAGE_NAME + ".OVERWRITE"; //$NON-NLS-1$
@@ -129,9 +117,12 @@
/**
* Create an instance of this class
+ *
+ * @param jarPackage an object containing all required information to make an export
+ * @param selection the initial selection
*/
public JarPackageWizardPage(JarPackageData jarPackage, IStructuredSelection selection) {
- super(PAGE_NAME, selection);
+ super(PAGE_NAME, selection, jarPackage);
setTitle(JarPackagerMessages.JarPackageWizardPage_title);
setDescription(JarPackagerMessages.JarPackageWizardPage_description);
fJarPackage= jarPackage;
@@ -207,39 +198,6 @@
}
/**
- * Answer the contents of the destination specification widget. If this
- * value does not have the required suffix then add it first.
- *
- * @return java.lang.String
- */
- protected String getDestinationValue() {
- String destinationText= fDestinationNamesCombo.getText().trim();
- if (destinationText.indexOf('.') < 0)
- destinationText += getOutputSuffix();
- return destinationText;
- }
-
- /**
- * Answer the string to display in self as the destination type
- *
- * @return java.lang.String
- */
- protected String getDestinationLabel() {
- return JarPackagerMessages.JarPackageWizardPage_destination_label;
- }
-
- /**
- * Answer the suffix that files exported from this wizard must have.
- * If this suffix is a file extension (which is typically the case)
- * then it must include the leading period character.
- *
- * @return java.lang.String
- */
- protected String getOutputSuffix() {
- return "." + JarPackagerUtil.JAR_EXTENSION; //$NON-NLS-1$
- }
-
- /**
* Returns an iterator over this page's collection of currently-specified
* elements to be exported. This is the primary element selection facility
* accessor for subclasses.
@@ -257,15 +215,10 @@
*
+ * The protocol defined by this interface is:
+ *
+
+ Added API for the jar packager:
+
+
+
+ org.eclipse.jdt.ui.jarpackager.IJarBuilder
org.eclipse.jdt.ui.jarpackager.JarPackageData
org.eclipse.jdt.ui.jarpackager.JarPackageData
org.eclipse.jdt.ui.jarpackager.JarPackageData
org.eclipse.jdt.ui.jarpackager.JarWriter3.addEntry(JarEntry, InputStream)
internalSaveWidgetValues
.
*/
public final void saveWidgetValues() {
+ super.saveWidgetValues();
// update directory names history
IDialogSettings settings= getDialogSettings();
if (settings != null) {
- String[] directoryNames= settings.getArray(STORE_DESTINATION_NAMES);
- if (directoryNames == null)
- directoryNames= new String[0];
- directoryNames= addToHistory(directoryNames, getDestinationValue());
- settings.put(STORE_DESTINATION_NAMES, directoryNames);
-
settings.put(STORE_EXPORT_CLASS_FILES, fJarPackage.areClassFilesExported());
settings.put(STORE_EXPORT_OUTPUT_FOLDERS, fJarPackage.areOutputFoldersExported());
settings.put(STORE_EXPORT_JAVA_FILES, fJarPackage.areJavaFilesExported());
@@ -298,21 +251,7 @@
fExportOutputFoldersCheckbox.setSelection(fJarPackage.areOutputFoldersExported());
fExportJavaFilesCheckbox.setSelection(fJarPackage.areJavaFilesExported());
- // destination
- if (fJarPackage.getJarLocation().isEmpty())
- fDestinationNamesCombo.setText(""); //$NON-NLS-1$
- else
- fDestinationNamesCombo.setText(fJarPackage.getJarLocation().toOSString());
- IDialogSettings settings= getDialogSettings();
- if (settings != null) {
- String[] directoryNames= settings.getArray(STORE_DESTINATION_NAMES);
- if (directoryNames == null)
- return; // ie.- no settings stored
- if (! fDestinationNamesCombo.getText().equals(directoryNames[0]))
- fDestinationNamesCombo.add(fDestinationNamesCombo.getText());
- for (int i= 0; i < directoryNames.length; i++)
- fDestinationNamesCombo.add(directoryNames[i]);
- }
+ super.restoreWidgetValues();
// options
if (fExportRefactoringsCheckbox != null)
@@ -326,6 +265,8 @@
* Initializes the JAR package from last used wizard page values.
*/
protected void initializeJarPackage() {
+ super.initializeJarPackage();
+
IDialogSettings settings= getDialogSettings();
if (settings != null) {
// source
@@ -339,12 +280,6 @@
fJarPackage.setCompress(settings.getBoolean(STORE_COMPRESS));
fJarPackage.setIncludeDirectoryEntries(settings.getBoolean(STORE_INCLUDE_DIRECTORY_ENTRIES));
fJarPackage.setOverwrite(settings.getBoolean(STORE_OVERWRITE));
-
- // destination
- String[] directoryNames= settings.getArray(STORE_DESTINATION_NAMES);
- if (directoryNames == null)
- return; // ie.- no settings stored
- fJarPackage.setJarLocation(Path.fromOSString(directoryNames[0]));
}
}
@@ -365,16 +300,7 @@
fJarPackage.setExportJavaFiles(fExportJavaFilesCheckbox.getSelection());
fJarPackage.setElements(getSelectedElements());
- // destination
- String comboText= fDestinationNamesCombo.getText();
- IPath path= Path.fromOSString(comboText);
-
- if (path.segmentCount() > 0 && ensureTargetFileIsValid(path.toFile()) && path.getFileExtension() == null)
- // append .jar
- path= path.addFileExtension(JarPackagerUtil.JAR_EXTENSION);
-
- fJarPackage.setJarLocation(path);
-
+ super.updateModel();
// options
if (fExportRefactoringsCheckbox != null)
fJarPackage.setRefactoringAware(fExportRefactoringsCheckbox.getSelection());
@@ -386,85 +312,6 @@
}
/**
- * Returns a boolean indicating whether the passed File handle is
- * is valid and available for use.
- *
- * @return boolean
- */
- protected boolean ensureTargetFileIsValid(File targetFile) {
- if (targetFile.exists() && targetFile.isDirectory() && fDestinationNamesCombo.getText().length() > 0) {
- setErrorMessage(JarPackagerMessages.JarPackageWizardPage_error_exportDestinationMustNotBeDirectory);
- fDestinationNamesCombo.setFocus();
- return false;
- }
- if (targetFile.exists()) {
- if (!targetFile.canWrite()) {
- setErrorMessage(JarPackagerMessages.JarPackageWizardPage_error_jarFileExistsAndNotWritable);
- fDestinationNamesCombo.setFocus();
- return false;
- }
- }
- return true;
- }
-
- /*
- * Overrides method from WizardExportPage
- */
- protected void createDestinationGroup(Composite parent) {
-
- initializeDialogUnits(parent);
-
- // destination specification group
- Composite destinationSelectionGroup= new Composite(parent, SWT.NONE);
- GridLayout layout= new GridLayout();
- layout.numColumns= 3;
- destinationSelectionGroup.setLayout(layout);
- destinationSelectionGroup.setLayoutData(new GridData(GridData.HORIZONTAL_ALIGN_FILL | GridData.VERTICAL_ALIGN_FILL));
-
- new Label(destinationSelectionGroup, SWT.NONE).setText(getDestinationLabel());
-
- // destination name entry field
- fDestinationNamesCombo= new Combo(destinationSelectionGroup, SWT.SINGLE | SWT.BORDER);
- fDestinationNamesCombo.addListener(SWT.Modify, this);
- fDestinationNamesCombo.addListener(SWT.Selection, this);
- GridData data= new GridData(GridData.HORIZONTAL_ALIGN_FILL | GridData.GRAB_HORIZONTAL);
- data.widthHint= SIZING_TEXT_FIELD_WIDTH;
- fDestinationNamesCombo.setLayoutData(data);
-
- // destination browse button
- fDestinationBrowseButton= new Button(destinationSelectionGroup, SWT.PUSH);
- fDestinationBrowseButton.setText(JarPackagerMessages.JarPackageWizardPage_browseButton_text);
- fDestinationBrowseButton.setLayoutData(new GridData(GridData.HORIZONTAL_ALIGN_FILL));
- SWTUtil.setButtonDimensionHint(fDestinationBrowseButton);
- fDestinationBrowseButton.addSelectionListener(new SelectionAdapter() {
- public void widgetSelected(SelectionEvent e) {
- handleDestinationBrowseButtonPressed();
- }
- });
- }
-
- /**
- * Open an appropriate destination browser so that the user can specify a source
- * to import from
- */
- protected void handleDestinationBrowseButtonPressed() {
- FileDialog dialog= new FileDialog(getContainer().getShell(), SWT.SAVE);
- dialog.setFilterExtensions(new String[] {"*.jar", "*.zip"}); //$NON-NLS-1$ //$NON-NLS-2$
-
- String currentSourceString= getDestinationValue();
- int lastSeparatorIndex= currentSourceString.lastIndexOf(File.separator);
- if (lastSeparatorIndex != -1) {
- dialog.setFilterPath(currentSourceString.substring(0, lastSeparatorIndex));
- dialog.setFileName(currentSourceString.substring(lastSeparatorIndex + 1, currentSourceString.length()));
- }
- else
- dialog.setFileName(currentSourceString);
- String selectedFileName= dialog.open();
- if (selectedFileName != null)
- fDestinationNamesCombo.setText(selectedFileName);
- }
-
- /**
* Returns the resource for the specified path.
*
* @param path the path for which the resource should be returned
@@ -655,21 +502,6 @@
setErrorMessage(null);
return complete;
}
-
- /*
- * Implements method from Listener
- */
- public void handleEvent(Event e) {
- if (getControl() == null)
- return;
- update();
- }
-
- protected void update() {
- updateModel();
- updateWidgetEnablements();
- updatePageCompletion();
- }
protected void updatePageCompletion() {
boolean pageComplete= isPageComplete();
@@ -691,51 +523,6 @@
/*
* Overrides method from WizardDataTransferPage
*/
- protected boolean validateDestinationGroup() {
- if (fDestinationNamesCombo.getText().length() == 0) {
- // Clear error
- if (getErrorMessage() != null)
- setErrorMessage(null);
- if (getMessage() != null)
- setMessage(null);
- return false;
- }
- if (fJarPackage.getAbsoluteJarLocation().toString().endsWith("/")) { //$NON-NLS-1$
- setErrorMessage(JarPackagerMessages.JarPackageWizardPage_error_exportDestinationMustNotBeDirectory);
- fDestinationNamesCombo.setFocus();
- return false;
- }
- // Check if the Jar is put into the workspace and conflicts with the containers
- // exported. If the workspace isn't on the local files system we are fine since
- // the Jar is always created in the local file system
- IPath workspaceLocation= ResourcesPlugin.getWorkspace().getRoot().getLocation();
- if (workspaceLocation != null && workspaceLocation.isPrefixOf(fJarPackage.getAbsoluteJarLocation())) {
- int segments= workspaceLocation.matchingFirstSegments(fJarPackage.getAbsoluteJarLocation());
- IPath path= fJarPackage.getAbsoluteJarLocation().removeFirstSegments(segments);
- IResource resource= ResourcesPlugin.getWorkspace().getRoot().findMember(path);
- if (resource != null && resource.getType() == IResource.FILE) {
- // test if included
- if (JarPackagerUtil.contains(JarPackagerUtil.asResources(fJarPackage.getElements()), (IFile)resource)) {
- setErrorMessage(JarPackagerMessages.JarPackageWizardPage_error_cantExportJARIntoItself);
- return false;
- }
- }
- }
- // Inform user about relative directory
- String currentMessage= getMessage();
- if (!(new File(fDestinationNamesCombo.getText()).isAbsolute())) {
- if (currentMessage == null)
- setMessage(JarPackagerMessages.JarPackageWizardPage_info_relativeExportDestination, IMessageProvider.INFORMATION);
- } else {
- if (currentMessage != null)
- setMessage(null);
- }
- return ensureTargetFileIsValid(fJarPackage.getAbsoluteJarLocation().toFile());
- }
-
- /*
- * Overrides method from WizardDataTransferPage
- */
protected boolean validateOptionsGroup() {
return true;
}
@@ -799,13 +586,6 @@
return null;
}
- /**
- * Set the current input focus to self's destination entry field
- */
- protected void giveFocusToDestination() {
- fDestinationNamesCombo.setFocus();
- }
-
/*
* Overrides method from WizardExportResourcePage
*/
@@ -849,13 +629,6 @@
}
/*
- * Implements method from IJarPackageWizardPage.
- */
- public void finish() {
- saveWidgetValues();
- }
-
- /*
* Method declared on IWizardPage.
*/
public void setPreviousPage(IWizardPage page) {
Index: ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackagerUtil.java
===================================================================
RCS file: /cvsroot/eclipse/org.eclipse.jdt.ui/ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackagerUtil.java,v
retrieving revision 1.26
diff -u -r1.26 JarPackagerUtil.java
--- ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackagerUtil.java 8 Jun 2006 16:14:26 -0000 1.26
+++ ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackagerUtil.java 4 Oct 2007 13:50:13 -0000
@@ -1,5 +1,5 @@
/*******************************************************************************
- * Copyright (c) 2000, 2006 IBM Corporation and others.
+ * Copyright (c) 2000, 2007 IBM Corporation and others.
* All rights reserved. This program and the accompanying materials
* are made available under the terms of the Eclipse Public License v1.0
* which accompanies this distribution, and is available at
@@ -13,20 +13,28 @@
import java.io.File;
import java.io.IOException;
import java.io.InputStream;
+import java.net.URI;
import java.util.ArrayList;
import java.util.Arrays;
import java.util.Iterator;
import java.util.List;
import java.util.jar.JarEntry;
import java.util.zip.CRC32;
+import java.util.zip.ZipException;
+import java.util.zip.ZipFile;
+
+import org.eclipse.core.filesystem.EFS;
+import org.eclipse.core.filesystem.IFileStore;
import org.eclipse.core.runtime.CoreException;
+import org.eclipse.core.runtime.IPath;
import org.eclipse.core.runtime.IStatus;
import org.eclipse.core.runtime.Status;
import org.eclipse.core.resources.IContainer;
import org.eclipse.core.resources.IFile;
import org.eclipse.core.resources.IResource;
+import org.eclipse.core.resources.ResourcesPlugin;
import org.eclipse.swt.widgets.Display;
import org.eclipse.swt.widgets.Shell;
@@ -107,14 +115,15 @@
* Computes and returns the elements as resources.
* The underlying resource is used for Java elements.
*
+ * @param elements elements for which to retrieve the resources from
* @return a List with the selected resources
*/
- public static List asResources(Object[] fSelectedElements) {
- if (fSelectedElements == null)
+ public static List asResources(Object[] elements) {
+ if (elements == null)
return null;
- List selectedResources= new ArrayList(fSelectedElements.length);
- for (int i= 0; i < fSelectedElements.length; i++) {
- Object element= fSelectedElements[i];
+ List selectedResources= new ArrayList(elements.length);
+ for (int i= 0; i < elements.length; i++) {
+ Object element= elements[i];
if (element instanceof IJavaElement) {
selectedResources.add(((IJavaElement)element).getResource());
}
@@ -133,6 +142,7 @@
/**
* Gets the name of the manifest's main class
*
+ * @param jarPackage
* @return a string with the name
*/
static String getMainClassName(JarPackageData jarPackage) {
@@ -173,6 +183,8 @@
/**
* Tells whether the specified manifest main class is valid.
*
+ * @param data
+ * @param context
* @return true
if a main class is specified and valid
*/
public static boolean isMainClassValid(JarPackageData data, IRunnableContext context) {
@@ -257,4 +269,45 @@
entry.setSize(size);
entry.setCrc(crc.getValue());
}
+
+ /**
+ * The archive file at the given location
+ *
+ * @param location
+ * the location of the archive file
+ * @return the archive or null if it could not be retrieved
+ * @throws CoreException
+ * if the archive could not be read
+ *
+ * @since 3.4
+ */
+ public static ZipFile getArchiveFile(IPath location) throws CoreException {
+ File localFile= null;
+
+ IResource file= ResourcesPlugin.getWorkspace().getRoot().findMember(location);
+ if (file != null) {
+ // internal resource
+ URI fileLocation= file.getLocationURI();
+
+ IFileStore fileStore= EFS.getStore(fileLocation);
+ localFile= fileStore.toLocalFile(EFS.NONE, null);
+ if (localFile == null)
+ // non local file system
+ localFile= fileStore.toLocalFile(EFS.CACHE, null);
+ } else {
+ // external resource -> it is ok to use toFile()
+ localFile= location.toFile();
+ }
+
+ if (localFile == null)
+ return null;
+
+ try {
+ return new ZipFile(localFile);
+ } catch (ZipException e) {
+ throw new CoreException(new Status(IStatus.ERROR, JavaUI.ID_PLUGIN, e.getLocalizedMessage(), e));
+ } catch (IOException e) {
+ throw new CoreException(new Status(IStatus.ERROR, JavaUI.ID_PLUGIN, e.getLocalizedMessage(), e));
+ }
+ }
}
\ No newline at end of file
Index: ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackagerMessages.java
===================================================================
RCS file: /cvsroot/eclipse/org.eclipse.jdt.ui/ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackagerMessages.java,v
retrieving revision 1.16
diff -u -r1.16 JarPackagerMessages.java
--- ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackagerMessages.java 18 Apr 2006 16:27:32 -0000 1.16
+++ ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackagerMessages.java 4 Oct 2007 13:50:13 -0000
@@ -1,5 +1,5 @@
/*******************************************************************************
- * Copyright (c) 2000, 2006 IBM Corporation and others.
+ * Copyright (c) 2000, 2007 IBM Corporation and others.
* All rights reserved. This program and the accompanying materials
* are made available under the terms of the Eclipse Public License v1.0
* which accompanies this distribution, and is available at
@@ -32,6 +32,8 @@
public static String JarFileExportOperation_creationOfSomeJARsFailed;
+ public static String JarFileExportOperation_OpenZipFileError_message;
+
public static String JarFileExportOperation_didNotAddManifestToJar;
public static String JarFileExportOperation_errorCannotCloseConnection;
@@ -48,7 +50,7 @@
public static String JarFileExportOperation_errorSavingManifest;
- public static String JarFileExportOperation_errorSavingModifiedResources;
+ public static String JarFileExportOperation_CloseZipFileError_message;
public static String JarFileExportOperation_exportedWithCompileErrors;
@@ -94,10 +96,6 @@
public static String JarFileExportOperation_savingFiles;
- public static String JarFileExportOperation_savingModifiedResources;
-
- public static String JarFileExportOperation_underlyingResourceNotFound;
-
public static String JarManifestWizardPage_description;
public static String JarManifestWizardPage_error_invalidMainClass;
@@ -248,6 +246,8 @@
public static String JarPackageReader_error_tagPathNotFound;
+ public static String JarPackageReader_error_unknownJarBuilder;
+
public static String JarPackageReader_jarPackageReaderWarnings;
public static String JarPackageReader_warning_javaElementDoesNotExist;
@@ -320,38 +320,6 @@
public static String JarWriter_error_couldNotTransformToXML;
- public static String JarWriter_output_compressed;
-
- public static String JarWriter_output_descriptionFile;
-
- public static String JarWriter_output_exportBin;
-
- public static String JarWriter_output_exportJava;
-
- public static String JarWriter_output_exportOutputFolders;
-
- public static String JarWriter_output_generateManifest;
-
- public static String JarWriter_output_jarFileName;
-
- public static String JarWriter_output_jarSealed;
-
- public static String JarWriter_output_lineSeparator;
-
- public static String JarWriter_output_mainClass;
-
- public static String JarWriter_output_manifestName;
-
- public static String JarWriter_output_overwrite;
-
- public static String JarWriter_output_reuseManifest;
-
- public static String JarWriter_output_saveDescription;
-
- public static String JarWriter_output_saveManifest;
-
- public static String JarWriter_output_title;
-
public static String JarWriter_writeProblem;
public static String JarWriter_writeProblemWithMessage;
Index: ui/org/eclipse/jdt/internal/ui/jarpackager/JarFileExportOperation.java
===================================================================
RCS file: /cvsroot/eclipse/org.eclipse.jdt.ui/ui/org/eclipse/jdt/internal/ui/jarpackager/JarFileExportOperation.java,v
retrieving revision 1.100
diff -u -r1.100 JarFileExportOperation.java
--- ui/org/eclipse/jdt/internal/ui/jarpackager/JarFileExportOperation.java 23 Aug 2007 13:48:47 -0000 1.100
+++ ui/org/eclipse/jdt/internal/ui/jarpackager/JarFileExportOperation.java 4 Oct 2007 13:50:13 -0000
@@ -29,8 +29,10 @@
import java.util.Set;
import java.util.jar.Manifest;
import java.util.zip.ZipException;
+import java.util.zip.ZipFile;
import org.eclipse.core.filesystem.EFS;
+
import org.eclipse.core.runtime.CoreException;
import org.eclipse.core.runtime.IPath;
import org.eclipse.core.runtime.IProgressMonitor;
@@ -73,10 +75,10 @@
import org.eclipse.jdt.internal.corext.util.Resources;
import org.eclipse.jdt.ui.StandardJavaElementContentProvider;
+import org.eclipse.jdt.ui.jarpackager.IJarBuilder;
import org.eclipse.jdt.ui.jarpackager.IJarDescriptionWriter;
import org.eclipse.jdt.ui.jarpackager.IJarExportRunnable;
import org.eclipse.jdt.ui.jarpackager.JarPackageData;
-import org.eclipse.jdt.ui.jarpackager.JarWriter3;
import org.eclipse.jdt.internal.ui.IJavaStatusConstants;
import org.eclipse.jdt.internal.ui.JavaPlugin;
@@ -100,7 +102,7 @@
}
}
- private JarWriter3 fJarWriter;
+ private IJarBuilder fJarBuilder;
private JarPackageData fJarPackage;
private JarPackageData[] fJarPackages;
private Shell fParentShell;
@@ -206,9 +208,21 @@
continue;
}
- // Should not happen since we only export source files
- if (resource == null)
+ if (resource == null) {
+ if (element instanceof IPackageFragmentRoot) {
+ IPackageFragmentRoot root= (IPackageFragmentRoot) element;
+ if (root.isArchive()) {
+ try {
+ ZipFile file= JarPackagerUtil.getArchiveFile(root.getPath());
+ if (file != null)
+ count+= file.size();
+ } catch (CoreException e) {
+ JavaPlugin.log(e);
+ }
+ }
+ }
continue;
+ }
}
else
resource= (IResource)element;
@@ -340,8 +354,25 @@
}
private void exportJavaElement(IProgressMonitor progressMonitor, IJavaElement je) throws InterruptedException {
- if (je.getElementType() == IJavaElement.PACKAGE_FRAGMENT_ROOT && ((IPackageFragmentRoot)je).isArchive())
+ if (je.getElementType() == IJavaElement.PACKAGE_FRAGMENT_ROOT && ((IPackageFragmentRoot) je).isArchive()) {
+ IPackageFragmentRoot root= (IPackageFragmentRoot) je;
+ ZipFile jarFile= null;
+ try {
+ jarFile= JarPackagerUtil.getArchiveFile(root.getPath());
+ fJarBuilder.writeArchive(jarFile, progressMonitor);
+ } catch (CoreException e) {
+ addWarning(Messages.format(JarPackagerMessages.JarFileExportOperation_OpenZipFileError_message, new Object[] { root.getElementName(), e.getLocalizedMessage() }), e);
+ } finally {
+ try {
+ if (jarFile != null) {
+ jarFile.close();
+ }
+ } catch (IOException e) {
+ addWarning(Messages.format(JarPackagerMessages.JarFileExportOperation_CloseZipFileError_message, new Object[] { root.getElementName(), e.getLocalizedMessage() }), e);
+ }
+ }
return;
+ }
Object[] children= fJavaElementContentProvider.getChildren(je);
for (int i= 0; i < children.length; i++)
@@ -365,7 +396,7 @@
try {
IPath destinationPath= resource.getFullPath().removeFirstSegments(leadingSegmentsToRemove);
progressMonitor.subTask(Messages.format(JarPackagerMessages.JarFileExportOperation_exporting, destinationPath.toString()));
- fJarWriter.write((IFile)resource, destinationPath);
+ fJarBuilder.writeFile((IFile)resource, destinationPath);
} catch (CoreException ex) {
Throwable realEx= ex.getStatus().getException();
if (realEx instanceof ZipException && realEx.getMessage() != null && realEx.getMessage().startsWith("duplicate entry:")) //$NON-NLS-1$
@@ -428,7 +459,7 @@
|| (fJarPackage.areJavaFilesExported() && (isNonJavaResource || (pkgRoot != null && !isClassFile(resource)) || (isInClassFolder && isClassFile(resource) && !fJarPackage.areClassFilesExported())))) {
try {
progressMonitor.subTask(Messages.format(JarPackagerMessages.JarFileExportOperation_exporting, destinationPath.toString()));
- fJarWriter.write((IFile) resource, destinationPath);
+ fJarBuilder.writeFile((IFile)resource, destinationPath);
} catch (CoreException ex) {
Throwable realEx= ex.getStatus().getException();
if (realEx instanceof ZipException && realEx.getMessage() != null && realEx.getMessage().startsWith("duplicate entry:")) //$NON-NLS-1$
@@ -462,7 +493,7 @@
IFile file= (IFile)iter.next();
IPath classFilePath= baseDestinationPath.append(file.getName());
progressMonitor.subTask(Messages.format(JarPackagerMessages.JarFileExportOperation_exporting, classFilePath.toString()));
- fJarWriter.write(file, classFilePath);
+ fJarBuilder.writeFile(file, classFilePath);
}
} catch (CoreException ex) {
addToStatus(ex);
@@ -857,8 +888,10 @@
buildProjects(subProgressMonitor);
} else
progressMonitor.beginTask("", totalWork); //$NON-NLS-1$
-
- fJarWriter= fJarPackage.createJarWriter3(fParentShell);
+
+ fJarBuilder = fJarPackage.getJarBuilder();
+ fJarBuilder.open(fJarPackage, fParentShell, fStatus);
+
exportSelectedElements(progressMonitor);
if (getStatus().getSeverity() != IStatus.ERROR) {
progressMonitor.subTask(JarPackagerMessages.JarFileExportOperation_savingFiles);
@@ -868,8 +901,8 @@
addToStatus(ex);
} finally {
try {
- if (fJarWriter != null)
- fJarWriter.close();
+ if (fJarBuilder != null)
+ fJarBuilder.close();
} catch (CoreException ex) {
addToStatus(ex);
}
Index: ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackagerMessages.properties
===================================================================
RCS file: /cvsroot/eclipse/org.eclipse.jdt.ui/ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackagerMessages.properties,v
retrieving revision 1.58
diff -u -r1.58 JarPackagerMessages.properties
--- ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackagerMessages.properties 5 Jun 2007 11:40:50 -0000 1.58
+++ ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackagerMessages.properties 4 Oct 2007 13:50:13 -0000
@@ -34,9 +34,9 @@
JarFileExportOperation_exportFinishedWithInfo= JAR export finished. See details for additional information.
JarFileExportOperation_exportFinishedWithWarnings= JAR export finished with warnings. See details for additional information.
JarFileExportOperation_creationOfSomeJARsFailed= Creation of some JARs failed. See details for additional information.
+JarFileExportOperation_OpenZipFileError_message=Could not read jar file ''{0}''. Reason: {1}
JarFileExportOperation_jarCreationFailed= JAR creation failed. See details for additional information.
-JarFileExportOperation_underlyingResourceNotFound= Underlying resource not found for compilation unit: {0}
JarFileExportOperation_resourceNotFound= Resource not found or not accessible: {0}
JarFileExportOperation_projectNatureNotDeterminable= Project nature could not be determined for: {0}
JarFileExportOperation_javaPackageNotDeterminable= Java package could not be found for: {0}
@@ -45,6 +45,7 @@
JarFileExportOperation_outputContainerNotAccessible= Output container not accessible
JarFileExportOperation_classFileOnClasspathNotAccessible= class file(s) on classpath not found or not accessible {0}
JarFileExportOperation_classFileWithoutSourceFileAttribute= Could not find source file attribute for: {0}
+JarFileExportOperation_CloseZipFileError_message=Could not close jar file ''{0}''. Reason: {1}
JarFileExportOperation_missingSourceFileAttributeExportedAll= Source name not found in a class file - exported all class files in {0}
JarFileExportOperation_exportedWithCompileErrors= Exported with compile errors: {0}
JarFileExportOperation_exportedWithCompileWarnings= Exported with compile warnings: {0}
@@ -53,7 +54,6 @@
JarFileExportOperation_exporting= Exporting: {0}
JarFileExportOperation_jarCreationFailedSeeDetails= JAR creation failed. See details for additional information.
JarFileExportOperation_savingFiles= Saving files...
-JarFileExportOperation_savingModifiedResources= Saving modified resources...
JarFileExportOperation_noExportTypeChosen= No export type chosen
JarFileExportOperation_noResourcesSelected= No resources selected
JarFileExportOperation_invalidJarLocation= Invalid JAR location
@@ -68,7 +68,6 @@
JarFileExportOperation_errorReadingFile= Error reading {0}: {1}
JarFileExportOperation_errorClosingJarPackageDescriptionReader= Error closing JAR package description reader for {0}
JarFileExportOperation_errorDuringProjectBuild= Build failed for project: {0}
-JarFileExportOperation_errorSavingModifiedResources= Unexpected exception while saving modified resources. See log for details.
JarFileExportOperation_errorCannotCloseConnection=Cannot close connection for ''{0}''
JarOptionsPage_title= JAR Packaging Options
@@ -118,6 +117,7 @@
JarPackageReader_error_illegalValueForBooleanAttribute= Invalid format. The value for a boolean attribute is invalid.
JarPackageReader_error_tagNameNotFound= Invalid format. The tag 'name' cannot be found.
JarPackageReader_error_tagPathNotFound= Invalid format. The tag 'path' cannot be found.
+JarPackageReader_error_unknownJarBuilder=Jar builder ''{0}'' is unkown
JarPackageReader_error_tagHandleIdentifierNotFoundOrEmpty= Invalid format: The tag 'handleIdentifier' cannot be found or is empty.
JarPackageReader_warning_javaElementDoesNotExist= Warning: Java element does not exist in workspace
JarPackageReader_error_duplicateTag= Invalid format. {0} is a duplicate tag.
@@ -179,20 +179,4 @@
JarRefactoringDialog_dialog_title=Refactoring Selection
JarWriter_error_couldNotGetXmlBuilder = Could not get XML builder
-JarWriter_error_couldNotTransformToXML= Could not transform to XML
-JarWriter_output_title= --- JAR Package Definition: ---
-JarWriter_output_exportBin= Export class files: {0}
-JarWriter_output_exportOutputFolders= Export output folders: {0}
-JarWriter_output_exportJava= Export java files: {0}
-JarWriter_output_jarFileName= JAR file: {0}
-JarWriter_output_compressed= Compressed: {0}
-JarWriter_output_overwrite= Overwrite: {0}
-JarWriter_output_saveDescription= Save description: {0}
-JarWriter_output_descriptionFile= Description file: {0}
-JarWriter_output_lineSeparator= --
-JarWriter_output_generateManifest= Generate manifest {0}
-JarWriter_output_saveManifest= Save manifest: {0}
-JarWriter_output_reuseManifest= Reuse manifest: {0}
-JarWriter_output_manifestName= Manifest {0}
-JarWriter_output_jarSealed= JAR sealed: {0}
-JarWriter_output_mainClass= Main-Class: {0}
+JarWriter_error_couldNotTransformToXML= Could not transform to XML
\ No newline at end of file
Index: ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackageReader.java
===================================================================
RCS file: /cvsroot/eclipse/org.eclipse.jdt.ui/ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackageReader.java,v
retrieving revision 1.38
diff -u -r1.38 JarPackageReader.java
--- ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackageReader.java 31 Aug 2006 09:59:16 -0000 1.38
+++ ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackageReader.java 4 Oct 2007 13:50:13 -0000
@@ -1,5 +1,5 @@
/*******************************************************************************
- * Copyright (c) 2000, 2006 IBM Corporation and others.
+ * Copyright (c) 2000, 2007 IBM Corporation and others.
* All rights reserved. This program and the accompanying materials
* are made available under the terms of the Eclipse Public License v1.0
* which accompanies this distribution, and is available at
@@ -23,11 +23,6 @@
import javax.xml.parsers.DocumentBuilderFactory;
import javax.xml.parsers.ParserConfigurationException;
-import org.eclipse.core.resources.IFile;
-import org.eclipse.core.resources.IFolder;
-import org.eclipse.core.resources.IProject;
-import org.eclipse.core.resources.ResourcesPlugin;
-
import org.eclipse.core.runtime.Assert;
import org.eclipse.core.runtime.CoreException;
import org.eclipse.core.runtime.IPath;
@@ -36,6 +31,10 @@
import org.eclipse.core.runtime.Path;
import org.eclipse.core.runtime.Status;
+import org.eclipse.core.resources.IFile;
+import org.eclipse.core.resources.IFolder;
+import org.eclipse.core.resources.IProject;
+import org.eclipse.core.resources.ResourcesPlugin;
import org.eclipse.ltk.core.refactoring.RefactoringCore;
import org.eclipse.ltk.core.refactoring.RefactoringDescriptor;
@@ -43,12 +42,6 @@
import org.eclipse.ltk.core.refactoring.history.IRefactoringHistoryService;
import org.eclipse.ltk.core.refactoring.history.RefactoringHistory;
-import org.w3c.dom.Element;
-import org.w3c.dom.Node;
-import org.w3c.dom.NodeList;
-import org.xml.sax.InputSource;
-import org.xml.sax.SAXException;
-
import org.eclipse.jdt.core.IJavaElement;
import org.eclipse.jdt.core.IPackageFragment;
import org.eclipse.jdt.core.IType;
@@ -56,11 +49,19 @@
import org.eclipse.jdt.internal.corext.util.Messages;
+import org.eclipse.jdt.ui.jarpackager.IJarBuilder;
import org.eclipse.jdt.ui.jarpackager.IJarDescriptionReader;
import org.eclipse.jdt.ui.jarpackager.JarPackageData;
-import org.eclipse.jdt.internal.ui.JavaPlugin;
import org.eclipse.jdt.internal.ui.IJavaStatusConstants;
+import org.eclipse.jdt.internal.ui.JavaPlugin;
+import org.eclipse.jdt.internal.ui.jarpackagerfat.FatJarBuilder;
+
+import org.w3c.dom.Element;
+import org.w3c.dom.Node;
+import org.w3c.dom.NodeList;
+import org.xml.sax.InputSource;
+import org.xml.sax.SAXException;
/**
* Reads data from an InputStream and returns a JarPackage
@@ -74,6 +75,7 @@
/**
* Reads a Jar Package from the underlying stream.
* It is the client's responsibility to close the stream.
+ * @param inputStream
*/
public JarPackageReader(InputStream inputStream) {
Assert.isNotNull(inputStream);
@@ -139,6 +141,9 @@
if (jarPackage.areGeneratedFilesExported())
xmlReadManifest(jarPackage, element);
xmlReadSelectedElements(jarPackage, element);
+
+ // fatjar read builder props
+ xmlReadFatjar(jarPackage, element);
}
return jarPackage;
}
@@ -403,4 +408,22 @@
protected void addWarning(String message, Throwable error) {
fWarnings.add(new Status(IStatus.WARNING, JavaPlugin.getPluginId(), 0, message, error));
}
+
+ private void xmlReadFatjar(JarPackageData jarPackage, Element element) throws java.io.IOException {
+ if (element.getNodeName().equals("fatjar")) { //$NON-NLS-1$
+ String id = element.getAttribute("builder"); //$NON-NLS-1$
+ IJarBuilder builder= jarPackage.getJarBuilder();
+ if (builder == null || !builder.getId().equals(id)) {
+ if (FatJarBuilder.BUILDER_ID.equals(id)) {
+ jarPackage.setJarBuilder(jarPackage.createFatJarBuilder());
+ } else if (PlainJarBuilder.BUILDER_ID.equals(id)) {
+ jarPackage.setJarBuilder(jarPackage.createPlainJarBuilder());
+ } else {
+ throw new IOException(Messages.format(JarPackagerMessages.JarPackageReader_error_unknownJarBuilder, id));
+ }
+ }
+ jarPackage.setLaunchConfigurationName(element.getAttribute("launchConfig")); //$NON-NLS-1$
+ }
+ }
+
}
Index: ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackageWriter.java
===================================================================
RCS file: /cvsroot/eclipse/org.eclipse.jdt.ui/ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackageWriter.java,v
retrieving revision 1.37
diff -u -r1.37 JarPackageWriter.java
--- ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackageWriter.java 31 Aug 2006 09:59:16 -0000 1.37
+++ ui/org/eclipse/jdt/internal/ui/jarpackager/JarPackageWriter.java 4 Oct 2007 13:50:13 -0000
@@ -1,5 +1,5 @@
/*******************************************************************************
- * Copyright (c) 2000, 2006 IBM Corporation and others.
+ * Copyright (c) 2000, 2007 IBM Corporation and others.
* All rights reserved. This program and the accompanying materials
* are made available under the terms of the Eclipse Public License v1.0
* which accompanies this distribution, and is available at
@@ -34,7 +34,6 @@
import org.eclipse.core.resources.IProject;
import org.eclipse.core.resources.IResource;
-
import org.eclipse.ltk.core.refactoring.RefactoringCore;
import org.eclipse.ltk.core.refactoring.RefactoringDescriptor;
import org.eclipse.ltk.core.refactoring.RefactoringDescriptorProxy;
@@ -64,6 +63,9 @@
/**
* Create a JarPackageWriter on the given output stream.
* It is the clients responsibility to close the output stream.
+ *
+ * @param outputStream
+ * @param encoding
*/
public JarPackageWriter(OutputStream outputStream, String encoding) {
Assert.isNotNull(outputStream);
@@ -84,6 +86,7 @@
* Writes a XML representation of the JAR specification
* to to the underlying stream.
*
+ * @param jarPackage
* @exception IOException if writing to the underlying stream fails
*/
public void writeXML(JarPackageData jarPackage) throws IOException {
@@ -109,6 +112,8 @@
xmlWriteManifest(jarPackage, document, xmlJarDesc);
xmlWriteSelectedElements(jarPackage, document, xmlJarDesc);
+ xmlWriteFatjar(jarPackage, document, xmlJarDesc);
+
try {
// Write the document to the stream
Transformer transformer=TransformerFactory.newInstance().newTransformer();
@@ -285,4 +290,11 @@
public IStatus getStatus() {
return new Status(IStatus.OK, JavaPlugin.getPluginId(), 0, "", null); //$NON-NLS-1$
}
+
+ private void xmlWriteFatjar(JarPackageData jarPackage, Document document, Element xmlJarDesc) throws DOMException {
+ Element fatjar= document.createElement("fatjar"); //$NON-NLS-1$
+ xmlJarDesc.appendChild(fatjar);
+ fatjar.setAttribute("builder", jarPackage.getJarBuilder().getId()); //$NON-NLS-1$
+ fatjar.setAttribute("launchConfig", jarPackage.getLaunchConfigurationName()); //$NON-NLS-1$
+ }
}
Index: ui/org/eclipse/jdt/internal/ui/JavaPluginImages.java
===================================================================
RCS file: /cvsroot/eclipse/org.eclipse.jdt.ui/ui/org/eclipse/jdt/internal/ui/JavaPluginImages.java,v
retrieving revision 1.128
diff -u -r1.128 JavaPluginImages.java
--- ui/org/eclipse/jdt/internal/ui/JavaPluginImages.java 23 Aug 2007 10:44:59 -0000 1.128
+++ ui/org/eclipse/jdt/internal/ui/JavaPluginImages.java 4 Oct 2007 13:50:13 -0000
@@ -394,6 +394,7 @@
public static final ImageDescriptor DESC_WIZBAN_REFACTOR_PULL_UP= createUnManaged(T_WIZBAN, "pullup_wiz.png"); //$NON-NLS-1$
public static final ImageDescriptor DESC_WIZBAN_REFACTOR_FIX_DEPRECATION= createUnManaged(T_WIZBAN, "fixdepr_wiz.png"); //$NON-NLS-1$
public static final ImageDescriptor DESC_WIZBAN_JAR_PACKAGER= createUnManaged(T_WIZBAN, "jar_pack_wiz.png"); //$NON-NLS-1$
+ public static final ImageDescriptor DESC_WIZBAN_FAT_JAR_PACKAGER= createUnManaged(T_WIZBAN, "fatjar_pack_wiz.png"); //$NON-NLS-1$
public static final ImageDescriptor DESC_WIZBAN_REFACTOR_EXTRACT_SUPERTYPE= createUnManaged(T_WIZBAN, "extractsupertype_wiz.png"); //$NON-NLS-1$
public static final ImageDescriptor DESC_WIZBAN_REPLACE_JAR= createUnManaged(T_WIZBAN, "replacejar_wiz.png"); //$NON-NLS-1$
public static final ImageDescriptor DESC_WIZBAN_JAVA_WORKINGSET= createUnManaged(T_WIZBAN, "java_workingset_wiz.png");//$NON-NLS-1$
Index: ui/org/eclipse/jdt/ui/jarpackager/JarWriter3.java
===================================================================
RCS file: /cvsroot/eclipse/org.eclipse.jdt.ui/ui/org/eclipse/jdt/ui/jarpackager/JarWriter3.java,v
retrieving revision 1.20
diff -u -r1.20 JarWriter3.java
--- ui/org/eclipse/jdt/ui/jarpackager/JarWriter3.java 3 Oct 2007 09:16:40 -0000 1.20
+++ ui/org/eclipse/jdt/ui/jarpackager/JarWriter3.java 4 Oct 2007 13:50:14 -0000
@@ -233,14 +233,30 @@
InputStream contentStream = resource.getContents(false);
+ addEntry(newEntry, contentStream);
+ }
+
+ /**
+ * Write the given entry describing the given content to the
+ * current archive
+ *
+ * @param entry the entry to write
+ * @param content the content to write
+ *
+ * @throws IOException If an I/O error occurred
+ *
+ * @since 3.4
+ */
+ protected void addEntry(JarEntry entry, InputStream content) throws IOException {
+ byte[] readBuffer= new byte[4096];
try {
- fJarOutputStream.putNextEntry(newEntry);
+ fJarOutputStream.putNextEntry(entry);
int count;
- while ((count= contentStream.read(readBuffer, 0, readBuffer.length)) != -1)
+ while ((count= content.read(readBuffer, 0, readBuffer.length)) != -1)
fJarOutputStream.write(readBuffer, 0, count);
} finally {
- if (contentStream != null)
- contentStream.close();
+ if (content != null)
+ content.close();
/*
* Commented out because some JREs throw an NPE if a stream
Index: ui/org/eclipse/jdt/ui/jarpackager/JarPackageData.java
===================================================================
RCS file: /cvsroot/eclipse/org.eclipse.jdt.ui/ui/org/eclipse/jdt/ui/jarpackager/JarPackageData.java,v
retrieving revision 1.42
diff -u -r1.42 JarPackageData.java
--- ui/org/eclipse/jdt/ui/jarpackager/JarPackageData.java 22 Jun 2006 09:14:49 -0000 1.42
+++ ui/org/eclipse/jdt/ui/jarpackager/JarPackageData.java 4 Oct 2007 13:50:14 -0000
@@ -1,5 +1,5 @@
/*******************************************************************************
- * Copyright (c) 2000, 2006 IBM Corporation and others.
+ * Copyright (c) 2000, 2007 IBM Corporation and others.
* All rights reserved. This program and the accompanying materials
* are made available under the terms of the Eclipse Public License v1.0
* which accompanies this distribution, and is available at
@@ -13,15 +13,15 @@
import java.io.InputStream;
import java.io.OutputStream;
-import org.eclipse.core.resources.IFile;
-import org.eclipse.core.resources.IProject;
-import org.eclipse.core.resources.ResourcesPlugin;
-
import org.eclipse.core.runtime.Assert;
import org.eclipse.core.runtime.CoreException;
import org.eclipse.core.runtime.IPath;
import org.eclipse.core.runtime.Path;
+import org.eclipse.core.resources.IFile;
+import org.eclipse.core.resources.IProject;
+import org.eclipse.core.resources.ResourcesPlugin;
+
import org.eclipse.swt.widgets.Shell;
import org.eclipse.jface.operation.IRunnableContext;
@@ -31,13 +31,13 @@
import org.eclipse.jdt.core.IPackageFragment;
import org.eclipse.jdt.core.IType;
-
import org.eclipse.jdt.internal.ui.JavaPlugin;
import org.eclipse.jdt.internal.ui.jarpackager.JarFileExportOperation;
import org.eclipse.jdt.internal.ui.jarpackager.JarPackageReader;
import org.eclipse.jdt.internal.ui.jarpackager.JarPackageWriter;
import org.eclipse.jdt.internal.ui.jarpackager.JarPackagerUtil;
-import org.eclipse.jdt.internal.ui.jarpackager.ManifestProvider;
+import org.eclipse.jdt.internal.ui.jarpackager.PlainJarBuilder;
+import org.eclipse.jdt.internal.ui.jarpackagerfat.FatJarBuilder;
import org.eclipse.jdt.internal.ui.util.BusyIndicatorRunnableContext;
/**
@@ -144,6 +144,12 @@
// The refactoring descriptors to export
private RefactoringDescriptorProxy[] fRefactoringDescriptors= {};
+ // Builder used by the JarFileExportOperation to build the jar file
+ private IJarBuilder fJarBuilder;
+
+ // The launch configuration used by the fat jar builder to determine dependencies
+ private String fLaunchConfigurationName;
+
/**
* Creates a new Jar Package Data structure
*/
@@ -474,7 +480,7 @@
*/
public IManifestProvider getManifestProvider() {
if (fManifestProvider == null)
- fManifestProvider= new ManifestProvider();
+ return getJarBuilder().getManifestProvider();
return fManifestProvider;
}
@@ -876,12 +882,37 @@
* @throws CoreException if an unexpected exception happens
*
* @since 3.2
+ * @deprecated use {@link #createPlainJarBuilder()} instead
*/
public JarWriter3 createJarWriter3(Shell parent) throws CoreException {
return new JarWriter3(this, parent);
}
/**
+ * Creates and returns a jar builder capable of handling
+ * files but not archives.
+ *
+ * @return a new instance of a plain jar builder
+ *
+ * @since 3.4
+ */
+ public IJarBuilder createPlainJarBuilder() {
+ return new PlainJarBuilder();
+ }
+
+ /**
+ * Creates and returns a jar builder capable of handling
+ * files and archives.
+ *
+ * @return a new instance of a fat jar builder
+ *
+ * @since 3.4
+ */
+ public IJarBuilder createFatJarBuilder() {
+ return new FatJarBuilder();
+ }
+
+ /**
* Creates and returns a JarExportRunnable.
*
* @param parent the parent for the dialog,
@@ -1162,4 +1193,52 @@
public void setExportStructuralOnly(boolean structural) {
fRefactoringStructural= structural;
}
+
+ /**
+ * Returns the jar builder which can be used to build the jar
+ * described by this package data.
+ *
+ * @return the builder to use
+ * @since 3.4
+ */
+ public IJarBuilder getJarBuilder() {
+ if (fJarBuilder == null)
+ fJarBuilder= createPlainJarBuilder();
+ return fJarBuilder;
+ }
+
+ /**
+ * Set the jar builder to use to build the jar.
+ *
+ * @param jarBuilder
+ * the builder to use
+ * @since 3.4
+ */
+ public void setJarBuilder(IJarBuilder jarBuilder) {
+ fJarBuilder= jarBuilder;
+ }
+
+ /**
+ * Get the name of the launch configuration from
+ * which to retrieve classpath information.
+ *
+ * @return the name of the launch configuration
+ * @since 3.4
+ */
+ public String getLaunchConfigurationName() {
+ return fLaunchConfigurationName;
+ }
+
+ /**
+ * Set the name of the launch configuration form which
+ * to retrieve classpath information.
+ *
+ * @param name
+ * name of the launch configuration
+ * @since 3.4
+ */
+ public void setLaunchConfigurationName(String name) {
+ fLaunchConfigurationName= name;
+ }
+
}
Index: META-INF/MANIFEST.MF
===================================================================
RCS file: /cvsroot/eclipse/org.eclipse.jdt.ui/META-INF/MANIFEST.MF,v
retrieving revision 1.56
diff -u -r1.56 MANIFEST.MF
--- META-INF/MANIFEST.MF 4 Sep 2007 08:40:24 -0000 1.56
+++ META-INF/MANIFEST.MF 4 Oct 2007 13:50:12 -0000
@@ -53,6 +53,7 @@
org.eclipse.jdt.internal.ui.infoviews;x-internal:=true,
org.eclipse.jdt.internal.ui.jarimport;x-internal:=true,
org.eclipse.jdt.internal.ui.jarpackager;x-internal:=true,
+ org.eclipse.jdt.internal.ui.jarpackagerfat;x-internal:=true,
org.eclipse.jdt.internal.ui.javadocexport;x-internal:=true,
org.eclipse.jdt.internal.ui.javaeditor;x-friends:="org.eclipse.jdt.junit",
org.eclipse.jdt.internal.ui.javaeditor.saveparticipant;x-internal:=true,
Index: ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarPackageWizardPage.java
===================================================================
RCS file: ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarPackageWizardPage.java
diff -N ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarPackageWizardPage.java
--- /dev/null 1 Jan 1970 00:00:00 -0000
+++ ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarPackageWizardPage.java 1 Jan 1970 00:00:00 -0000
@@ -0,0 +1,515 @@
+/*******************************************************************************
+ * Copyright (c) 2007 IBM Corporation and others.
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Eclipse Public License v1.0
+ * which accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * IBM Corporation - initial API and implementation
+ *******************************************************************************/
+package org.eclipse.jdt.internal.ui.jarpackagerfat;
+
+import java.lang.reflect.InvocationTargetException;
+import java.util.ArrayList;
+import java.util.Arrays;
+import java.util.HashSet;
+import java.util.Iterator;
+import java.util.List;
+
+import org.eclipse.core.runtime.CoreException;
+import org.eclipse.core.runtime.IPath;
+import org.eclipse.core.runtime.IStatus;
+import org.eclipse.core.runtime.MultiStatus;
+import org.eclipse.core.runtime.Path;
+import org.eclipse.core.runtime.Status;
+
+import org.eclipse.core.resources.IProject;
+import org.eclipse.core.resources.IResource;
+import org.eclipse.core.resources.ResourcesPlugin;
+
+import org.eclipse.swt.SWT;
+import org.eclipse.swt.layout.GridData;
+import org.eclipse.swt.layout.GridLayout;
+import org.eclipse.swt.widgets.Combo;
+import org.eclipse.swt.widgets.Composite;
+import org.eclipse.swt.widgets.Label;
+import org.eclipse.swt.widgets.Listener;
+
+import org.eclipse.jface.dialogs.Dialog;
+import org.eclipse.jface.dialogs.IDialogSettings;
+import org.eclipse.jface.operation.IRunnableContext;
+import org.eclipse.jface.viewers.IStructuredSelection;
+
+import org.eclipse.debug.core.DebugPlugin;
+import org.eclipse.debug.core.ILaunchConfiguration;
+import org.eclipse.debug.core.ILaunchConfigurationType;
+import org.eclipse.debug.core.ILaunchManager;
+
+import org.eclipse.jdt.core.IClasspathEntry;
+import org.eclipse.jdt.core.IJavaProject;
+import org.eclipse.jdt.core.IPackageFragmentRoot;
+import org.eclipse.jdt.core.IType;
+import org.eclipse.jdt.core.JavaCore;
+import org.eclipse.jdt.core.JavaModelException;
+import org.eclipse.jdt.core.search.IJavaSearchScope;
+
+import org.eclipse.jdt.internal.corext.util.Messages;
+
+import org.eclipse.jdt.launching.IJavaLaunchConfigurationConstants;
+import org.eclipse.jdt.launching.IRuntimeClasspathEntry;
+import org.eclipse.jdt.launching.JavaRuntime;
+
+import org.eclipse.jdt.ui.JavaUI;
+import org.eclipse.jdt.ui.jarpackager.JarPackageData;
+
+import org.eclipse.jdt.internal.ui.JavaPlugin;
+import org.eclipse.jdt.internal.ui.jarpackager.AbstractJarDestinationWizardPage;
+import org.eclipse.jdt.internal.ui.jarpackager.JarPackagerUtil;
+import org.eclipse.jdt.internal.ui.search.JavaSearchScopeFactory;
+import org.eclipse.jdt.internal.ui.util.MainMethodSearchEngine;
+
+/**
+ * First page for the runnable jar export wizard
+ * @since 3.4
+ */
+public class FatJarPackageWizardPage extends AbstractJarDestinationWizardPage implements Listener {
+
+ private abstract static class LaunchConfigurationElement {
+
+ public abstract ILaunchConfiguration getLaunchConfiguration();
+
+ public abstract String getLaunchConfigurationName();
+
+ public void dispose() {
+ //do nothing
+ }
+ }
+
+ private static class ExistingLaunchConfigurationElement extends LaunchConfigurationElement {
+
+ private final ILaunchConfiguration fLaunchConfiguration;
+ private final String fProjectName;
+
+ public ExistingLaunchConfigurationElement(ILaunchConfiguration launchConfiguration, String projectName) {
+ fLaunchConfiguration= launchConfiguration;
+ fProjectName= projectName;
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public ILaunchConfiguration getLaunchConfiguration() {
+ return fLaunchConfiguration;
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public String getLaunchConfigurationName() {
+ return fProjectName + " : " + fLaunchConfiguration.getName(); //$NON-NLS-1$
+ }
+
+ }
+
+ private static final String PAGE_NAME= "FatJarPackageWizardPage"; //$NON-NLS-1$
+ private static final String STORE_LAUNCH_CONFIGURATION_SELECTION_NAME= PAGE_NAME + ".LAUNCH_CONFIGURATION_SELECTION_NAME"; //$NON-NLS-1$
+ private static final String STORE_DESTINATION_ELEMENT= PAGE_NAME + ".DESTINATION_PATH_SELECTION"; //$NON-NLS-1$
+
+ private final JarPackageData fJarPackage;
+ /**
+ * Model for the launch combo box. Element: {@link LaunchConfigurationElement}
+ */
+ private final ArrayList fLauchConfigurationModel;
+
+ private Combo fLaunchConfigurationCombo;
+
+ public FatJarPackageWizardPage(JarPackageData jarPackage, IStructuredSelection selection) {
+ super(PAGE_NAME, selection, jarPackage);
+ setTitle(FatJarPackagerMessages.JarPackageWizardPage_title);
+ setDescription(FatJarPackagerMessages.FatJarPackageWizardPage_description);
+ fJarPackage= jarPackage;
+ fLauchConfigurationModel= new ArrayList();
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public void createControl(Composite parent) {
+ Composite composite= new Composite(parent, SWT.NONE);
+ composite.setLayoutData(new GridData(SWT.FILL, SWT.FILL, true, true));
+ composite.setLayout(new GridLayout(1, false));
+
+ Label description= new Label(composite, SWT.NONE);
+ GridData gridData= new GridData(SWT.BEGINNING, SWT.CENTER, false, false);
+ description.setLayoutData(gridData);
+ description.setText(FatJarPackagerMessages.FatJarPackageWizardPage_launchConfigGroupTitle);
+
+ createLaunchConfigSelectionGroup(composite);
+
+ Label label= new Label(composite, SWT.NONE);
+ label.setLayoutData(new GridData(SWT.BEGINNING, SWT.CENTER, false, false));
+ label.setText(FatJarPackagerMessages.FatJarPackageWizardPage_destinationGroupTitle);
+
+ createDestinationGroup(composite);
+
+ restoreWidgetValues();
+
+ update();
+
+ Dialog.applyDialogFont(composite);
+ setControl(composite);
+ }
+
+ protected String getDestinationLabel() {
+ return null;
+ }
+
+ private void createLaunchConfigSelectionGroup(Composite parent) {
+ Composite composite= new Composite(parent, SWT.NONE);
+ composite.setLayoutData(new GridData(SWT.FILL, SWT.TOP, true, false));
+ composite.setLayout(new GridLayout(1, false));
+
+ fLaunchConfigurationCombo= new Combo(composite, SWT.DROP_DOWN | SWT.READ_ONLY);
+ fLaunchConfigurationCombo.setLayoutData(new GridData(SWT.FILL, SWT.CENTER, true, false));
+
+ fLauchConfigurationModel.addAll(Arrays.asList(getLaunchConfigurations()));
+ String[] names= new String[fLauchConfigurationModel.size()];
+ for (int i= 0, size= fLauchConfigurationModel.size(); i < size; i++) {
+ LaunchConfigurationElement element= (LaunchConfigurationElement) fLauchConfigurationModel.get(i);
+ names[i]= element.getLaunchConfigurationName();
+ }
+ fLaunchConfigurationCombo.setItems(names);
+
+ fLaunchConfigurationCombo.addListener(SWT.Selection, this);
+ fLaunchConfigurationCombo.addListener(SWT.Modify, this);
+ }
+
+ protected void updateWidgetEnablements() {
+ }
+
+ public boolean isPageComplete() {
+ boolean complete= validateDestinationGroup();
+ complete= validateLaunchConfigurationGroup() && complete;
+ if (complete)
+ setErrorMessage(null);
+ return complete;
+ }
+
+ private boolean validateLaunchConfigurationGroup() {
+ return fLaunchConfigurationCombo.getSelectionIndex() != -1;
+ }
+
+ private LaunchConfigurationElement[] getLaunchConfigurations() {
+ ArrayList result= new ArrayList();
+
+ try {
+ ILaunchManager manager= DebugPlugin.getDefault().getLaunchManager();
+ ILaunchConfigurationType type= manager.getLaunchConfigurationType(IJavaLaunchConfigurationConstants.ID_JAVA_APPLICATION);
+ ILaunchConfiguration[] launchconfigs= manager.getLaunchConfigurations(type);
+
+ for (int i= 0; i < launchconfigs.length; i++) {
+ ILaunchConfiguration launchconfig= launchconfigs[i];
+
+ String projectName= launchconfig.getAttribute(IJavaLaunchConfigurationConstants.ATTR_PROJECT_NAME, ""); //$NON-NLS-1$
+ result.add(new ExistingLaunchConfigurationElement(launchconfig, projectName));
+ }
+ } catch (CoreException e) {
+ JavaPlugin.log(e);
+ }
+
+ return (LaunchConfigurationElement[]) result.toArray(new LaunchConfigurationElement[result.size()]);
+ }
+
+ public Object[] getSelectedElementsWithoutContainedChildren(MultiStatus status) {
+ try {
+ LaunchConfigurationElement element= (LaunchConfigurationElement) fLauchConfigurationModel.get(fLaunchConfigurationCombo.getSelectionIndex());
+ ILaunchConfiguration launchconfig= element.getLaunchConfiguration();
+ fJarPackage.setLaunchConfigurationName(element.getLaunchConfigurationName());
+
+ return getSelectedElementsWithoutContainedChildren(launchconfig, fJarPackage, getContainer(), status);
+ } catch (CoreException e) {
+ JavaPlugin.log(e);
+ }
+
+ return null;
+ }
+
+ private static IJavaProject[] getProjectSearchOrder(String projectName) {
+
+ ArrayList projectNames= new ArrayList();
+ projectNames.add(projectName);
+
+ int nextProject= 0;
+ while (nextProject < projectNames.size()) {
+ String nextProjectName= (String) projectNames.get(nextProject);
+ IJavaProject jproject= getJavaProject(nextProjectName);
+
+ if (jproject != null) {
+ try {
+ String[] childProjectNames= jproject.getRequiredProjectNames();
+ for (int i= 0; i < childProjectNames.length; i++) {
+ if (!projectNames.contains(childProjectNames[i])) {
+ projectNames.add(childProjectNames[i]);
+ }
+ }
+ } catch (JavaModelException e) {
+ JavaPlugin.log(e);
+ }
+ }
+ nextProject+= 1;
+ }
+
+ ArrayList result= new ArrayList();
+ for (int i= 0, size= projectNames.size(); i < size; i++) {
+ String name= (String) projectNames.get(i);
+ IJavaProject project= getJavaProject(name);
+ if (project != null)
+ result.add(project);
+ }
+
+ return (IJavaProject[]) result.toArray(new IJavaProject[result.size()]);
+ }
+
+ private static IJavaProject getJavaProject(String projectName) {
+ IProject project= ResourcesPlugin.getWorkspace().getRoot().getProject(projectName);
+ if (project == null)
+ return null;
+
+ IJavaProject result= JavaCore.create(project);
+ if (result == null)
+ return null;
+
+ if (!result.exists())
+ return null;
+
+ return result;
+ }
+
+ private static IPath[] getClasspath(ILaunchConfiguration configuration) throws CoreException {
+ IRuntimeClasspathEntry[] entries= JavaRuntime.computeUnresolvedRuntimeClasspath(configuration);
+ entries= JavaRuntime.resolveRuntimeClasspath(entries, configuration);
+
+ ArrayList userEntries= new ArrayList(entries.length);
+ for (int i= 0; i < entries.length; i++) {
+ if (entries[i].getClasspathProperty() == IRuntimeClasspathEntry.USER_CLASSES) {
+
+ String location= entries[i].getLocation();
+ if (location != null) {
+ IPath entry= Path.fromOSString(location);
+ if (!userEntries.contains(entry)) {
+ userEntries.add(entry);
+ }
+ }
+ }
+ }
+ return (IPath[]) userEntries.toArray(new IPath[userEntries.size()]);
+ }
+
+ private static String getMainClass(ILaunchConfiguration launchConfig, MultiStatus status) {
+ String result= null;
+ if (launchConfig != null) {
+ try {
+ result= launchConfig.getAttribute(IJavaLaunchConfigurationConstants.ATTR_MAIN_TYPE_NAME, (String) null);
+ } catch (CoreException e) {
+ JavaPlugin.log(e);
+ }
+ }
+ if (result == null) {
+ status.add(new Status(IStatus.WARNING, JavaUI.ID_PLUGIN, FatJarPackagerMessages.FatJarPackageWizardPage_LaunchConfigurationWithoutMainType_warning));
+ result= ""; //$NON-NLS-1$
+ }
+ return result;
+ }
+
+ /**
+ * @param classpathEntries the path to the package fragment roots
+ * @param projectName the root of the project dependency tree
+ * @param status a status to report problems to
+ * @return all package fragment roots corresponding to each classpath entry start the search at project with projectName
+ */
+ private static IPackageFragmentRoot[] getRequiredPackageFragmentRoots(IPath[] classpathEntries, final String projectName, MultiStatus status) {
+ HashSet result= new HashSet();
+
+ IJavaProject[] searchOrder= getProjectSearchOrder(projectName);
+
+ for (int i= 0; i < classpathEntries.length; i++) {
+ IPath entry= classpathEntries[i];
+ IPackageFragmentRoot[] elements= findRootsForClasspath(entry, searchOrder);
+ if (elements == null) {
+ status.add(new Status(IStatus.WARNING, JavaUI.ID_PLUGIN, Messages.format(FatJarPackagerMessages.FatJarPackageWizardPage_error_missingClassFile, entry)));
+ } else {
+ for (int j= 0; j < elements.length; j++) {
+ result.add(elements[j]);
+ }
+ }
+ }
+
+ return (IPackageFragmentRoot[]) result.toArray(new IPackageFragmentRoot[result.size()]);
+ }
+
+ private static IPackageFragmentRoot[] findRootsForClasspath(IPath entry, IJavaProject[] searchOrder) {
+ for (int i= 0; i < searchOrder.length; i++) {
+ IPackageFragmentRoot[] elements= findRootsInProject(entry, searchOrder[i]);
+ if (elements.length != 0) {
+ return elements;
+ }
+ }
+ return null;
+ }
+
+ private static IPackageFragmentRoot[] findRootsInProject(IPath entry, IJavaProject project) {
+ ArrayList result= new ArrayList();
+
+ try {
+ IPackageFragmentRoot[] roots= project.getPackageFragmentRoots();
+ for (int i= 0; i < roots.length; i++) {
+ IPackageFragmentRoot packageFragmentRoot= roots[i];
+ if (isRootAt(packageFragmentRoot, entry))
+ result.add(packageFragmentRoot);
+ }
+ } catch (Exception e) {
+ JavaPlugin.log(e);
+ }
+
+ return (IPackageFragmentRoot[]) result.toArray(new IPackageFragmentRoot[result.size()]);
+ }
+
+ private static boolean isRootAt(IPackageFragmentRoot root, IPath entry) {
+ try {
+ IClasspathEntry cpe= root.getRawClasspathEntry();
+ if (cpe.getEntryKind() == IClasspathEntry.CPE_SOURCE) {
+ IPath outputLocation= cpe.getOutputLocation();
+ if (outputLocation == null)
+ outputLocation= root.getJavaProject().getOutputLocation();
+
+ IPath location= ResourcesPlugin.getWorkspace().getRoot().findMember(outputLocation).getLocation();
+ if (entry.equals(location))
+ return true;
+ }
+ } catch (JavaModelException e) {
+ JavaPlugin.log(e);
+ }
+
+ IResource resource= root.getResource();
+ if (resource != null && entry.equals(resource.getLocation()))
+ return true;
+
+ IPath path= root.getPath();
+ if (path != null && entry.equals(path))
+ return true;
+
+ return false;
+ }
+
+ private static IType findMainMethodByName(String name, IPackageFragmentRoot[] classpathResources, IRunnableContext context) throws CoreException {
+
+ List resources= JarPackagerUtil.asResources(classpathResources);
+ if (resources == null) {
+ return null;
+ }
+
+ for (Iterator iterator= resources.iterator(); iterator.hasNext();) {
+ IResource element= (IResource) iterator.next();
+ if (element == null)
+ iterator.remove();
+ }
+
+ IJavaSearchScope searchScope= JavaSearchScopeFactory.getInstance().createJavaSearchScope((IResource[]) resources.toArray(new IResource[resources.size()]), true);
+ MainMethodSearchEngine engine= new MainMethodSearchEngine();
+ try {
+ IType[] mainTypes= engine.searchMainMethods(context, searchScope, 0);
+ for (int i= 0; i < mainTypes.length; i++) {
+ if (mainTypes[i].getFullyQualifiedName().equals(name))
+ return mainTypes[i];
+ }
+ } catch (InvocationTargetException ex) {
+ JavaPlugin.log(ex);
+ } catch (InterruptedException e) {
+ // null
+ }
+
+ return null;
+ }
+
+ public void dispose() {
+ super.dispose();
+ if (fLauchConfigurationModel != null) {
+ for (int i= 0, size= fLauchConfigurationModel.size(); i < size; i++) {
+ LaunchConfigurationElement element= (LaunchConfigurationElement) fLauchConfigurationModel.get(i);
+ element.dispose();
+ }
+ }
+ }
+
+ protected void restoreWidgetValues() {
+
+ IDialogSettings settings= getDialogSettings();
+ if (settings != null) {
+ String name= settings.get(STORE_LAUNCH_CONFIGURATION_SELECTION_NAME);
+ if (name != null) {
+ String[] items= fLaunchConfigurationCombo.getItems();
+ for (int i= 0; i < items.length; i++) {
+ if (name.equals(items[i])) {
+ fLaunchConfigurationCombo.select(i);
+ }
+ }
+ }
+
+ String destinationPath= settings.get(STORE_DESTINATION_ELEMENT);
+ if (destinationPath != null && destinationPath.length() > 0) {
+ fJarPackage.setJarLocation(Path.fromOSString(destinationPath));
+ }
+ }
+
+ super.restoreWidgetValues();
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected void saveWidgetValues() {
+ super.saveWidgetValues();
+
+ IDialogSettings settings= getDialogSettings();
+ if (settings != null) {
+ int index= fLaunchConfigurationCombo.getSelectionIndex();
+ if (index == -1) {
+ settings.put(STORE_LAUNCH_CONFIGURATION_SELECTION_NAME, ""); //$NON-NLS-1$
+ } else {
+ String selectedItem= fLaunchConfigurationCombo.getItem(index);
+ settings.put(STORE_LAUNCH_CONFIGURATION_SELECTION_NAME, selectedItem);
+ }
+
+ IPath location= fJarPackage.getJarLocation();
+ if (location == null) {
+ settings.put(STORE_DESTINATION_ELEMENT, ""); //$NON-NLS-1$
+ } else {
+ settings.put(STORE_DESTINATION_ELEMENT, location.toOSString());
+ }
+ }
+ }
+
+ /*
+ * For internal use only (testing), clients must not call.
+ */
+ public static Object[] getSelectedElementsWithoutContainedChildren(ILaunchConfiguration launchconfig, JarPackageData data, IRunnableContext context, MultiStatus status) throws CoreException {
+ if (launchconfig == null)
+ return new Object[0];
+
+ String projectName= launchconfig.getAttribute(IJavaLaunchConfigurationConstants.ATTR_PROJECT_NAME, ""); //$NON-NLS-1$
+
+ IPath[] classpath= getClasspath(launchconfig);
+ IPackageFragmentRoot[] classpathResources= getRequiredPackageFragmentRoots(classpath, projectName, status);
+
+ String mainClass= getMainClass(launchconfig, status);
+ IType mainType= findMainMethodByName(mainClass, classpathResources, context);
+ if (mainType == null) {
+ status.add(new Status(IStatus.ERROR, JavaUI.ID_PLUGIN, FatJarPackagerMessages.FatJarPackageWizardPage_error_noMainMethod));
+ }
+ data.setManifestMainClass(mainType);
+
+ return classpathResources;
+ }
+
+}
Index: ui/org/eclipse/jdt/internal/ui/jarpackager/JarBuilder.java
===================================================================
RCS file: ui/org/eclipse/jdt/internal/ui/jarpackager/JarBuilder.java
diff -N ui/org/eclipse/jdt/internal/ui/jarpackager/JarBuilder.java
--- /dev/null 1 Jan 1970 00:00:00 -0000
+++ ui/org/eclipse/jdt/internal/ui/jarpackager/JarBuilder.java 1 Jan 1970 00:00:00 -0000
@@ -0,0 +1,64 @@
+/*******************************************************************************
+ * Copyright (c) 2007 IBM Corporation and others.
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Eclipse Public License v1.0
+ * which accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * IBM Corporation - initial API and implementation
+ *******************************************************************************/
+package org.eclipse.jdt.internal.ui.jarpackager;
+
+import org.eclipse.core.runtime.CoreException;
+import org.eclipse.core.runtime.IStatus;
+import org.eclipse.core.runtime.MultiStatus;
+import org.eclipse.core.runtime.Status;
+
+import org.eclipse.swt.widgets.Shell;
+
+import org.eclipse.jdt.ui.jarpackager.IJarBuilder;
+import org.eclipse.jdt.ui.jarpackager.JarPackageData;
+
+import org.eclipse.jdt.internal.ui.IJavaStatusConstants;
+import org.eclipse.jdt.internal.ui.JavaPlugin;
+
+/**
+ * Base class for all jar builders.
+ *
+ * @since 3.4
+ */
+public abstract class JarBuilder implements IJarBuilder {
+
+ private MultiStatus fStatus;
+
+ /**
+ * {@inheritDoc}
+ */
+ public void open(JarPackageData jarPackage, Shell shell, MultiStatus status) throws CoreException {
+ fStatus= status;
+ }
+
+ //some methods for convenience
+ protected final void addInfo(String message, Throwable error) {
+ fStatus.add(new Status(IStatus.INFO, JavaPlugin.getPluginId(), IJavaStatusConstants.INTERNAL_ERROR, message, error));
+ }
+
+ protected final void addWarning(String message, Throwable error) {
+ fStatus.add(new Status(IStatus.WARNING, JavaPlugin.getPluginId(), IJavaStatusConstants.INTERNAL_ERROR, message, error));
+ }
+
+ protected final void addError(String message, Throwable error) {
+ fStatus.add(new Status(IStatus.ERROR, JavaPlugin.getPluginId(), IJavaStatusConstants.INTERNAL_ERROR, message, error));
+ }
+
+ protected final void addToStatus(CoreException ex) {
+ IStatus status= ex.getStatus();
+ String message= ex.getLocalizedMessage();
+ if (message == null || message.length() < 1) {
+ message= JarPackagerMessages.JarFileExportOperation_coreErrorDuringExport;
+ status= new Status(status.getSeverity(), status.getPlugin(), status.getCode(), message, ex);
+ }
+ fStatus.add(status);
+ }
+}
Index: ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarPackagerMessages.properties
===================================================================
RCS file: ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarPackagerMessages.properties
diff -N ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarPackagerMessages.properties
--- /dev/null 1 Jan 1970 00:00:00 -0000
+++ ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarPackagerMessages.properties 1 Jan 1970 00:00:00 -0000
@@ -0,0 +1,30 @@
+###############################################################################
+# Copyright (c) 2007 IBM Corporation and others.
+# All rights reserved. This program and the accompanying materials
+# are made available under the terms of the Eclipse Public License v1.0
+# which accompanies this distribution, and is available at
+# http://www.eclipse.org/legal/epl-v10.html
+#
+# Contributors:
+# IBM Corporation - initial API and implementation
+###############################################################################
+
+JarPackageWizard_windowTitle= Runnable JAR File Export
+JarPackageWizard_jarExport_title= Runnable JAR File Export
+JarPackageWizard_jarExportError_title= Runnable JAR Export Error
+JarPackageWizard_jarExportError_message= Creation of runnable JAR failed
+
+JarPackageWizardPage_title= Runnable JAR File Specification
+
+FatJarBuilder_error_readingArchiveFile=Could not read jar file ''{0}''. Reason: {1}
+
+FatJarPackageWizard_JarExportProblems_message=Jar export finished with problems. See details for additional infos.
+
+FatJarPackageWizardPage_description=Select a launch configuration to use to create a runnable JAR.
+FatJarPackageWizardPage_destinationGroupTitle=Select the export destination:
+FatJarPackageWizardPage_error_missingClassFile=Fat Jar Export: Could not find classpath entry for ''{0}''
+FatJarPackageWizard_IPIssueDialog_message=This operation does repack libraries. Make sure you have the required legal rights to do so.
+FatJarPackageWizard_IPIssueDialog_title=Runnable JAR File Export
+FatJarPackageWizardPage_error_noMainMethod=Could not find main method from given launch configuration.
+FatJarPackageWizardPage_launchConfigGroupTitle=Select the launch configuration:
+FatJarPackageWizardPage_LaunchConfigurationWithoutMainType_warning=The selected launch configuration has no type with a main method attached. The resulting jar will not be runnable.
Index: ui/org/eclipse/jdt/internal/ui/jarpackager/PlainJarBuilder.java
===================================================================
RCS file: ui/org/eclipse/jdt/internal/ui/jarpackager/PlainJarBuilder.java
diff -N ui/org/eclipse/jdt/internal/ui/jarpackager/PlainJarBuilder.java
--- /dev/null 1 Jan 1970 00:00:00 -0000
+++ ui/org/eclipse/jdt/internal/ui/jarpackager/PlainJarBuilder.java 1 Jan 1970 00:00:00 -0000
@@ -0,0 +1,84 @@
+/*******************************************************************************
+ * Copyright (c) 2007 IBM Corporation and others.
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Eclipse Public License v1.0
+ * which accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * IBM Corporation - initial API and implementation
+ *******************************************************************************/
+package org.eclipse.jdt.internal.ui.jarpackager;
+
+import java.util.zip.ZipFile;
+
+import org.eclipse.core.runtime.CoreException;
+import org.eclipse.core.runtime.IPath;
+import org.eclipse.core.runtime.IProgressMonitor;
+import org.eclipse.core.runtime.MultiStatus;
+
+import org.eclipse.core.resources.IFile;
+
+import org.eclipse.swt.widgets.Shell;
+
+import org.eclipse.jdt.ui.jarpackager.IManifestProvider;
+import org.eclipse.jdt.ui.jarpackager.JarPackageData;
+import org.eclipse.jdt.ui.jarpackager.JarWriter3;
+
+/**
+ * Jar builder for the plain jar exported. Does not export archives.
+ *
+ * @since 3.4
+ */
+public class PlainJarBuilder extends JarBuilder {
+
+ public static final String BUILDER_ID= "org.eclipse.jdt.ui.plain_jar_builder"; //$NON-NLS-1$
+
+ private JarPackageData fJarPackage;
+ private JarWriter3 fJarWriter;
+
+ /**
+ * {@inheritDoc}
+ */
+ public String getId() {
+ return BUILDER_ID;
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public IManifestProvider getManifestProvider() {
+ return new ManifestProvider();
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public void open(JarPackageData jarPackage, Shell displayShell, MultiStatus statusMsg) throws CoreException {
+ super.open(jarPackage, displayShell, statusMsg);
+ fJarPackage= jarPackage;
+ fJarWriter= new JarWriter3(fJarPackage, displayShell);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public void writeFile(IFile resource, IPath destinationPath) throws CoreException {
+ fJarWriter.write(resource, destinationPath);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public void writeArchive(ZipFile archiveRoot, IProgressMonitor progressMonitor) {
+ //do nothing, plain jar builder can not handle archives, use fat jar builder
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public void close() throws CoreException {
+ fJarWriter.close();
+ }
+
+}
Index: ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarPackagerMessages.java
===================================================================
RCS file: ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarPackagerMessages.java
diff -N ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarPackagerMessages.java
--- /dev/null 1 Jan 1970 00:00:00 -0000
+++ ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarPackagerMessages.java 1 Jan 1970 00:00:00 -0000
@@ -0,0 +1,48 @@
+/*******************************************************************************
+ * Copyright (c) 2007 IBM Corporation and others.
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Eclipse Public License v1.0
+ * which accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * IBM Corporation - initial API and implementation
+ *******************************************************************************/
+package org.eclipse.jdt.internal.ui.jarpackagerfat;
+
+import org.eclipse.osgi.util.NLS;
+
+public final class FatJarPackagerMessages extends NLS {
+
+ private static final String BUNDLE_NAME= "org.eclipse.jdt.internal.ui.jarpackagerfat.FatJarPackagerMessages";//$NON-NLS-1$
+
+ public static String JarPackageWizard_jarExport_title;
+ public static String JarPackageWizard_jarExportError_message;
+ public static String JarPackageWizard_jarExportError_title;
+ public static String JarPackageWizard_windowTitle;
+
+ public static String JarPackageWizardPage_title;
+
+ public static String FatJarBuilder_error_readingArchiveFile;
+
+ public static String FatJarPackageWizard_JarExportProblems_message;
+
+ public static String FatJarPackageWizardPage_destinationGroupTitle;
+ public static String FatJarPackageWizardPage_error_missingClassFile;
+ public static String FatJarPackageWizard_IPIssueDialog_message;
+
+ public static String FatJarPackageWizard_IPIssueDialog_title;
+
+ public static String FatJarPackageWizardPage_error_noMainMethod;
+ public static String FatJarPackageWizardPage_launchConfigGroupTitle;
+ public static String FatJarPackageWizardPage_LaunchConfigurationWithoutMainType_warning;
+ public static String FatJarPackageWizardPage_description;
+
+ static {
+ NLS.initializeMessages(BUNDLE_NAME, FatJarPackagerMessages.class);
+ }
+
+ private FatJarPackagerMessages() {
+ // Do not instantiate
+ }
+}
Index: ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarManifestProvider.java
===================================================================
RCS file: ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarManifestProvider.java
diff -N ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarManifestProvider.java
--- /dev/null 1 Jan 1970 00:00:00 -0000
+++ ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarManifestProvider.java 1 Jan 1970 00:00:00 -0000
@@ -0,0 +1,199 @@
+/*******************************************************************************
+ * Copyright (c) 2007 IBM Corporation and others.
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Eclipse Public License v1.0
+ * which accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * IBM Corporation - initial API and implementation
+ *******************************************************************************/
+package org.eclipse.jdt.internal.ui.jarpackagerfat;
+
+import java.io.IOException;
+import java.io.InputStream;
+import java.util.ArrayList;
+import java.util.Enumeration;
+import java.util.Iterator;
+import java.util.List;
+import java.util.Map;
+import java.util.jar.Attributes;
+import java.util.jar.Manifest;
+import java.util.zip.ZipEntry;
+import java.util.zip.ZipFile;
+
+import org.eclipse.core.runtime.CoreException;
+
+import org.eclipse.jdt.core.IPackageFragment;
+import org.eclipse.jdt.core.IPackageFragmentRoot;
+
+import org.eclipse.jdt.ui.jarpackager.IManifestProvider;
+import org.eclipse.jdt.ui.jarpackager.JarPackageData;
+
+import org.eclipse.jdt.internal.ui.JavaPlugin;
+import org.eclipse.jdt.internal.ui.jarpackager.JarPackagerUtil;
+
+/**
+ * A manifest provider creates manifest files for a fat jar.
+ *
+ * @since 3.4
+ */
+public class FatJarManifestProvider implements IManifestProvider {
+
+ private static final String SEALED_VALUE= "true"; //$NON-NLS-1$
+ private static final String UNSEALED_VALUE= "false"; //$NON-NLS-1$
+
+ private FatJarBuilder fBuilder;
+
+ public FatJarManifestProvider(FatJarBuilder builder) {
+ fBuilder= builder;
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public Manifest create(JarPackageData jarPackage) throws CoreException {
+ Manifest result;
+ Manifest ownManifest= createOwn(jarPackage);
+ setManifestClasspath(ownManifest, fBuilder.getManifestClasspath());
+ if (fBuilder.isMergeManifests()) {
+ List otherManifests= new ArrayList();
+ Object[] elements= jarPackage.getElements();
+ for (int i= 0; i < elements.length; i++) {
+ Object element= elements[i];
+ if (element instanceof IPackageFragmentRoot && ((IPackageFragmentRoot) element).isArchive()) {
+ ZipFile zip= JarPackagerUtil.getArchiveFile(((IPackageFragmentRoot) element).getPath());
+ Enumeration entries= zip.entries();
+ while (entries.hasMoreElements()) {
+ ZipEntry entry= (ZipEntry) entries.nextElement();
+ if (entry.getName().equalsIgnoreCase("META-INF/MANIFEST.MF")) { //$NON-NLS-1$
+ try {
+ Manifest otherManifest= new Manifest(zip.getInputStream(entry));
+ otherManifests.add(otherManifest);
+ } catch (IOException e) {
+ JavaPlugin.log(e);
+ }
+ }
+ }
+ }
+ }
+ result= merge(ownManifest, otherManifests);
+ } else {
+ result= ownManifest;
+ }
+ return result;
+ }
+
+ private void setManifestClasspath(Manifest ownManifest, String manifestClasspath) {
+ if ((manifestClasspath != null) && !manifestClasspath.trim().equals("")) { //$NON-NLS-1$
+ Attributes mainAttr= ownManifest.getMainAttributes();
+ mainAttr.putValue("Class-Path", manifestClasspath); //$NON-NLS-1$
+ }
+ }
+
+ private Manifest merge(Manifest ownManifest, List otherManifests) {
+ Manifest mergedManifest= new Manifest(ownManifest);
+ Map mergedEntries= mergedManifest.getEntries();
+ for (Iterator iter= otherManifests.iterator(); iter.hasNext();) {
+ Manifest otherManifest= (Manifest) iter.next();
+ Map otherEntries= otherManifest.getEntries();
+ for (Iterator iterator= otherEntries.keySet().iterator(); iterator.hasNext();) {
+ String attributeName= (String) iterator.next();
+ if (mergedEntries.containsKey(attributeName)) {
+ // TODO: WARNING
+ } else {
+ mergedEntries.put(attributeName, otherEntries.get(attributeName));
+ }
+ }
+ }
+ return mergedManifest;
+ }
+
+ private Manifest createOwn(JarPackageData jarPackage) throws CoreException {
+ if (jarPackage.isManifestGenerated())
+ return createGeneratedManifest(jarPackage);
+
+ try {
+ return createSuppliedManifest(jarPackage);
+ } catch (IOException ex) {
+ throw JarPackagerUtil.createCoreException(ex.getLocalizedMessage(), ex);
+ }
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public Manifest createDefault(String manifestVersion) {
+ Manifest manifest= new Manifest();
+ manifest.getMainAttributes().put(Attributes.Name.MANIFEST_VERSION, manifestVersion);
+ return manifest;
+ }
+
+ /**
+ * Hook for subclasses to add additional manifest entries.
+ *
+ * @param manifest the manifest to which the entries should be added
+ * @param jarPackage the JAR package specification
+ */
+ protected void putAdditionalEntries(Manifest manifest, JarPackageData jarPackage) {
+ }
+
+ private Manifest createGeneratedManifest(JarPackageData jarPackage) {
+ Manifest manifest= new Manifest();
+ putVersion(manifest, jarPackage);
+ putSealing(manifest, jarPackage);
+ putMainClass(manifest, jarPackage);
+ putAdditionalEntries(manifest, jarPackage);
+ return manifest;
+ }
+
+ private void putVersion(Manifest manifest, JarPackageData jarPackage) {
+ manifest.getMainAttributes().put(Attributes.Name.MANIFEST_VERSION, jarPackage.getManifestVersion());
+ }
+
+ private void putSealing(Manifest manifest, JarPackageData jarPackage) {
+ if (jarPackage.isJarSealed()) {
+ manifest.getMainAttributes().put(Attributes.Name.SEALED, SEALED_VALUE);
+ IPackageFragment[] packages= jarPackage.getPackagesToUnseal();
+ if (packages != null) {
+ for (int i= 0; i < packages.length; i++) {
+ Attributes attributes= new Attributes();
+ attributes.put(Attributes.Name.SEALED, UNSEALED_VALUE);
+ manifest.getEntries().put(getInManifestFormat(packages[i]), attributes);
+ }
+ }
+ } else {
+ IPackageFragment[] packages= jarPackage.getPackagesToSeal();
+ if (packages != null)
+ for (int i= 0; i < packages.length; i++) {
+ Attributes attributes= new Attributes();
+ attributes.put(Attributes.Name.SEALED, SEALED_VALUE);
+ manifest.getEntries().put(getInManifestFormat(packages[i]), attributes);
+ }
+ }
+ }
+
+ private void putMainClass(Manifest manifest, JarPackageData jarPackage) {
+ if (jarPackage.getManifestMainClass() != null && jarPackage.getManifestMainClass().getFullyQualifiedName().length() > 0)
+ manifest.getMainAttributes().put(Attributes.Name.MAIN_CLASS, jarPackage.getManifestMainClass().getFullyQualifiedName());
+ }
+
+ private String getInManifestFormat(IPackageFragment packageFragment) {
+ String name= packageFragment.getElementName();
+ return name.replace('.', '/') + '/';
+ }
+
+ private Manifest createSuppliedManifest(JarPackageData jarPackage) throws CoreException, IOException {
+ Manifest manifest;
+ // No need to use buffer here because Manifest(...) does
+ InputStream stream= jarPackage.getManifestFile().getContents(false);
+ try {
+ manifest= new Manifest(stream);
+ } finally {
+ if (stream != null)
+ stream.close();
+ }
+ return manifest;
+ }
+
+}
Index: ui/org/eclipse/jdt/ui/jarpackager/IJarBuilder.java
===================================================================
RCS file: ui/org/eclipse/jdt/ui/jarpackager/IJarBuilder.java
diff -N ui/org/eclipse/jdt/ui/jarpackager/IJarBuilder.java
--- /dev/null 1 Jan 1970 00:00:00 -0000
+++ ui/org/eclipse/jdt/ui/jarpackager/IJarBuilder.java 1 Jan 1970 00:00:00 -0000
@@ -0,0 +1,102 @@
+/*******************************************************************************
+ * Copyright (c) 2007 IBM Corporation and others.
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Eclipse Public License v1.0
+ * which accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * IBM Corporation - initial API and implementation
+ *******************************************************************************/
+package org.eclipse.jdt.ui.jarpackager;
+
+import java.util.zip.ZipFile;
+
+import org.eclipse.core.runtime.CoreException;
+import org.eclipse.core.runtime.IPath;
+import org.eclipse.core.runtime.IProgressMonitor;
+import org.eclipse.core.runtime.MultiStatus;
+
+import org.eclipse.core.resources.IFile;
+
+import org.eclipse.swt.widgets.Shell;
+
+
+
+/**
+ * A jar builder can be used to add elements to a
+ * jar file which is about to be build.
+ *
+ *
+ * It is guaranteed that addFile and addJar is only called after
+ * open is called and before close is called. Other methods may
+ * be called any time.
+ *
+ * EXPERIMENTAL This class or interface has been added as part
+ * of a work in progress. This API may change at any given time. Please do not
+ * use this API without consulting with the JDT/UI team. See bug 83258 for discussions.
+ *
+ * @see org.eclipse.jdt.ui.jarpackager.JarPackageData
+ * @since 3.4
+ */
+public interface IJarBuilder {
+
+ /**
+ * @return the unique id of this builder
+ */
+ public String getId();
+
+ /**
+ * @return the manifest provider to build the manifest
+ */
+ public IManifestProvider getManifestProvider();
+
+ /**
+ * Called when building of the jar starts
+ *
+ * @param jarPackage
+ * the package to build
+ * @param shell
+ * shell to show dialogs, null if no dialog must be shown
+ * @param status
+ * a status to use to report status to the user
+ * @throws CoreException
+ */
+ public void open(JarPackageData jarPackage, Shell shell, MultiStatus status) throws CoreException;
+
+ /**
+ * Add the given resource to the archive at the given path
+ *
+ * @param resource
+ * the file to be written
+ * @param destinationPath
+ * the path for the file inside the archive
+ * @throws CoreException
+ */
+ public void writeFile(IFile resource, IPath destinationPath) throws CoreException;
+
+ /**
+ * Add the given archive to the archive which is about to be build
+ *
+ * @param archive
+ * the archive to add
+ * @param monitor
+ * a monitor to report progress to
+ */
+ public void writeArchive(ZipFile archive, IProgressMonitor monitor);
+
+ /**
+ * Called when building of the jar finished.
+ *
+ * @throws CoreException
+ */
+ public void close() throws CoreException;
+
+}
Index: ui/org/eclipse/jdt/internal/ui/jarpackager/AbstractJarDestinationWizardPage.java
===================================================================
RCS file: ui/org/eclipse/jdt/internal/ui/jarpackager/AbstractJarDestinationWizardPage.java
diff -N ui/org/eclipse/jdt/internal/ui/jarpackager/AbstractJarDestinationWizardPage.java
--- /dev/null 1 Jan 1970 00:00:00 -0000
+++ ui/org/eclipse/jdt/internal/ui/jarpackager/AbstractJarDestinationWizardPage.java 1 Jan 1970 00:00:00 -0000
@@ -0,0 +1,319 @@
+/*******************************************************************************
+ * Copyright (c) 2007 IBM Corporation and others.
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Eclipse Public License v1.0
+ * which accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * IBM Corporation - initial API and implementation
+ *******************************************************************************/
+package org.eclipse.jdt.internal.ui.jarpackager;
+
+import java.io.File;
+
+import org.eclipse.core.runtime.IPath;
+import org.eclipse.core.runtime.Path;
+
+import org.eclipse.core.resources.IFile;
+import org.eclipse.core.resources.IResource;
+import org.eclipse.core.resources.ResourcesPlugin;
+
+import org.eclipse.swt.SWT;
+import org.eclipse.swt.events.SelectionAdapter;
+import org.eclipse.swt.events.SelectionEvent;
+import org.eclipse.swt.layout.GridData;
+import org.eclipse.swt.layout.GridLayout;
+import org.eclipse.swt.widgets.Button;
+import org.eclipse.swt.widgets.Combo;
+import org.eclipse.swt.widgets.Composite;
+import org.eclipse.swt.widgets.Event;
+import org.eclipse.swt.widgets.FileDialog;
+import org.eclipse.swt.widgets.Label;
+
+import org.eclipse.jface.dialogs.IDialogSettings;
+import org.eclipse.jface.dialogs.IMessageProvider;
+import org.eclipse.jface.viewers.IStructuredSelection;
+
+import org.eclipse.ui.dialogs.WizardExportResourcesPage;
+
+import org.eclipse.jdt.ui.jarpackager.JarPackageData;
+
+import org.eclipse.jdt.internal.ui.util.SWTUtil;
+
+/**
+ * A wizard page containing a destination block for a jar file. Including
+ * all required validation code. Clients should overwrite createControl
.
+ *
+ * @since 3.4
+ */
+public abstract class AbstractJarDestinationWizardPage extends WizardExportResourcesPage implements IJarPackageWizardPage {
+
+ private final String fStoreDestinationNamesId;
+
+ private Combo fDestinationNamesCombo;
+ private Button fDestinationBrowseButton;
+ private final JarPackageData fJarPackage;
+
+ public AbstractJarDestinationWizardPage(String pageName, IStructuredSelection selection, JarPackageData jarPackage) {
+ super(pageName, selection);
+ fStoreDestinationNamesId= pageName + ".DESTINATION_NAMES_ID"; //$NON-NLS-1$
+ fJarPackage= jarPackage;
+ }
+
+ /*
+ * Overrides method from WizardExportPage
+ */
+ protected void createDestinationGroup(Composite parent) {
+
+ initializeDialogUnits(parent);
+
+ // destination specification group
+ Composite destinationSelectionGroup= new Composite(parent, SWT.NONE);
+ GridLayout layout= new GridLayout();
+ layout.numColumns= 3;
+ destinationSelectionGroup.setLayout(layout);
+ destinationSelectionGroup.setLayoutData(new GridData(GridData.HORIZONTAL_ALIGN_FILL | GridData.VERTICAL_ALIGN_FILL));
+
+ String label= getDestinationLabel();
+ if (label != null) {
+ new Label(destinationSelectionGroup, SWT.NONE).setText(label);
+ }
+
+ // destination name entry field
+ fDestinationNamesCombo= new Combo(destinationSelectionGroup, SWT.SINGLE | SWT.BORDER);
+ fDestinationNamesCombo.addListener(SWT.Modify, this);
+ fDestinationNamesCombo.addListener(SWT.Selection, this);
+ GridData data= new GridData(GridData.HORIZONTAL_ALIGN_FILL | GridData.GRAB_HORIZONTAL);
+ data.widthHint= SIZING_TEXT_FIELD_WIDTH;
+ data.horizontalSpan= label == null ? 2 : 1;
+ fDestinationNamesCombo.setLayoutData(data);
+
+ // destination browse button
+ fDestinationBrowseButton= new Button(destinationSelectionGroup, SWT.PUSH);
+ fDestinationBrowseButton.setText(JarPackagerMessages.JarPackageWizardPage_browseButton_text);
+ fDestinationBrowseButton.setLayoutData(new GridData(GridData.HORIZONTAL_ALIGN_FILL));
+ SWTUtil.setButtonDimensionHint(fDestinationBrowseButton);
+ fDestinationBrowseButton.addSelectionListener(new SelectionAdapter() {
+ public void widgetSelected(SelectionEvent e) {
+ handleDestinationBrowseButtonPressed();
+ }
+ });
+ }
+
+ /**
+ * Open an appropriate destination browser so that the user can specify a source
+ * to import from
+ */
+ protected void handleDestinationBrowseButtonPressed() {
+ FileDialog dialog= new FileDialog(getContainer().getShell(), SWT.SAVE);
+ dialog.setFilterExtensions(new String[] { "*.jar", "*.zip" }); //$NON-NLS-1$ //$NON-NLS-2$
+
+ String currentSourceString= getDestinationValue();
+ int lastSeparatorIndex= currentSourceString.lastIndexOf(File.separator);
+ if (lastSeparatorIndex != -1) {
+ dialog.setFilterPath(currentSourceString.substring(0, lastSeparatorIndex));
+ dialog.setFileName(currentSourceString.substring(lastSeparatorIndex + 1, currentSourceString.length()));
+ } else
+ dialog.setFileName(currentSourceString);
+ String selectedFileName= dialog.open();
+ if (selectedFileName != null)
+ fDestinationNamesCombo.setText(selectedFileName);
+ }
+
+
+ /**
+ * Answer the contents of the destination specification widget. If this
+ * value does not have the required suffix then add it first.
+ *
+ * @return java.lang.String
+ */
+ protected String getDestinationValue() {
+ String destinationText= fDestinationNamesCombo.getText().trim();
+ if (destinationText.indexOf('.') < 0)
+ destinationText+= getOutputSuffix();
+ return destinationText;
+ }
+
+ /**
+ * Answer the string to display in self as the destination type
+ *
+ * @return java.lang.String
+ */
+ protected String getDestinationLabel() {
+ return JarPackagerMessages.JarPackageWizardPage_destination_label;
+ }
+
+ /**
+ * Answer the suffix that files exported from this wizard must have.
+ * If this suffix is a file extension (which is typically the case)
+ * then it must include the leading period character.
+ *
+ * @return java.lang.String
+ */
+ protected String getOutputSuffix() {
+ return "." + JarPackagerUtil.JAR_EXTENSION; //$NON-NLS-1$
+ }
+
+ protected void restoreWidgetValues() {
+ // destination
+ if (fJarPackage.getJarLocation().isEmpty())
+ fDestinationNamesCombo.setText(""); //$NON-NLS-1$
+ else
+ fDestinationNamesCombo.setText(fJarPackage.getJarLocation().toOSString());
+ IDialogSettings settings= getDialogSettings();
+ if (settings != null) {
+ String[] directoryNames= settings.getArray(fStoreDestinationNamesId);
+ if (directoryNames == null)
+ return; // ie.- no settings stored
+ if (!fDestinationNamesCombo.getText().equals(directoryNames[0]))
+ fDestinationNamesCombo.add(fDestinationNamesCombo.getText());
+ for (int i= 0; i < directoryNames.length; i++)
+ fDestinationNamesCombo.add(directoryNames[i]);
+ }
+ }
+
+ protected void updateModel() {
+ // destination
+ String comboText= fDestinationNamesCombo.getText();
+ IPath path= Path.fromOSString(comboText);
+
+ if (path.segmentCount() > 0 && ensureTargetFileIsValid(path.toFile()) && path.getFileExtension() == null)
+ // append .jar
+ path= path.addFileExtension(JarPackagerUtil.JAR_EXTENSION);
+
+ fJarPackage.setJarLocation(path);
+ }
+
+ /**
+ * Returns a boolean indicating whether the passed File handle is
+ * is valid and available for use.
+ *
+ * @param targetFile the target
+ * @return boolean
+ */
+ protected boolean ensureTargetFileIsValid(File targetFile) {
+ if (targetFile.exists() && targetFile.isDirectory() && fDestinationNamesCombo.getText().length() > 0) {
+ setErrorMessage(JarPackagerMessages.JarPackageWizardPage_error_exportDestinationMustNotBeDirectory);
+ fDestinationNamesCombo.setFocus();
+ return false;
+ }
+ if (targetFile.exists()) {
+ if (!targetFile.canWrite()) {
+ setErrorMessage(JarPackagerMessages.JarPackageWizardPage_error_jarFileExistsAndNotWritable);
+ fDestinationNamesCombo.setFocus();
+ return false;
+ }
+ }
+ return true;
+ }
+
+ /*
+ * Overrides method from WizardDataTransferPage
+ */
+ protected boolean validateDestinationGroup() {
+ if (fDestinationNamesCombo.getText().length() == 0) {
+ // Clear error
+ if (getErrorMessage() != null)
+ setErrorMessage(null);
+ if (getMessage() != null)
+ setMessage(null);
+ return false;
+ }
+ if (fJarPackage.getAbsoluteJarLocation().toString().endsWith("/")) { //$NON-NLS-1$
+ setErrorMessage(JarPackagerMessages.JarPackageWizardPage_error_exportDestinationMustNotBeDirectory);
+ fDestinationNamesCombo.setFocus();
+ return false;
+ }
+ // Check if the Jar is put into the workspace and conflicts with the containers
+ // exported. If the workspace isn't on the local files system we are fine since
+ // the Jar is always created in the local file system
+ IPath workspaceLocation= ResourcesPlugin.getWorkspace().getRoot().getLocation();
+ if (workspaceLocation != null && workspaceLocation.isPrefixOf(fJarPackage.getAbsoluteJarLocation())) {
+ int segments= workspaceLocation.matchingFirstSegments(fJarPackage.getAbsoluteJarLocation());
+ IPath path= fJarPackage.getAbsoluteJarLocation().removeFirstSegments(segments);
+ IResource resource= ResourcesPlugin.getWorkspace().getRoot().findMember(path);
+ if (resource != null && resource.getType() == IResource.FILE) {
+ // test if included
+ if (JarPackagerUtil.contains(JarPackagerUtil.asResources(fJarPackage.getElements()), (IFile) resource)) {
+ setErrorMessage(JarPackagerMessages.JarPackageWizardPage_error_cantExportJARIntoItself);
+ return false;
+ }
+ }
+ }
+ // Inform user about relative directory
+ String currentMessage= getMessage();
+ if (!(new File(fDestinationNamesCombo.getText()).isAbsolute())) {
+ if (currentMessage == null)
+ setMessage(JarPackagerMessages.JarPackageWizardPage_info_relativeExportDestination, IMessageProvider.INFORMATION);
+ } else {
+ if (currentMessage != null)
+ setMessage(null);
+ }
+ return ensureTargetFileIsValid(fJarPackage.getAbsoluteJarLocation().toFile());
+ }
+
+ /**
+ * Set the current input focus to self's destination entry field
+ */
+ protected void giveFocusToDestination() {
+ fDestinationNamesCombo.setFocus();
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ protected void saveWidgetValues() {
+ IDialogSettings settings= getDialogSettings();
+ if (settings != null) {
+ String[] directoryNames= settings.getArray(fStoreDestinationNamesId);
+ if (directoryNames == null)
+ directoryNames= new String[0];
+ directoryNames= addToHistory(directoryNames, getDestinationValue());
+ settings.put(fStoreDestinationNamesId, directoryNames);
+ }
+ }
+
+ /**
+ * Initializes the JAR package from last used wizard page values.
+ */
+ protected void initializeJarPackage() {
+ IDialogSettings settings= getDialogSettings();
+ if (settings != null) {
+ // destination
+ String[] directoryNames= settings.getArray(fStoreDestinationNamesId);
+ if (directoryNames == null)
+ return; // ie.- no settings stored
+ fJarPackage.setJarLocation(Path.fromOSString(directoryNames[0]));
+ }
+ }
+
+ /*
+ * Implements method from IJarPackageWizardPage.
+ */
+ public void finish() {
+ saveWidgetValues();
+ }
+
+ /*
+ * Implements method from Listener
+ */
+ public void handleEvent(Event e) {
+ if (getControl() == null)
+ return;
+ update();
+ }
+
+ protected void update() {
+ updateModel();
+ updateWidgetEnablements();
+ updatePageCompletion();
+ }
+
+ protected void updatePageCompletion() {
+ boolean pageComplete= isPageComplete();
+ setPageComplete(pageComplete);
+ if (pageComplete)
+ setErrorMessage(null);
+ }
+}
Index: ui/org/eclipse/jdt/internal/ui/jarpackagerfat/JarWriter4.java
===================================================================
RCS file: ui/org/eclipse/jdt/internal/ui/jarpackagerfat/JarWriter4.java
diff -N ui/org/eclipse/jdt/internal/ui/jarpackagerfat/JarWriter4.java
--- /dev/null 1 Jan 1970 00:00:00 -0000
+++ ui/org/eclipse/jdt/internal/ui/jarpackagerfat/JarWriter4.java 1 Jan 1970 00:00:00 -0000
@@ -0,0 +1,57 @@
+/*******************************************************************************
+ * Copyright (c) 2007 IBM Corporation and others.
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Eclipse Public License v1.0
+ * which accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * IBM Corporation - initial API and implementation
+ *******************************************************************************/
+package org.eclipse.jdt.internal.ui.jarpackagerfat;
+
+import java.io.File;
+import java.io.IOException;
+import java.util.jar.JarEntry;
+import java.util.zip.ZipEntry;
+import java.util.zip.ZipFile;
+
+import org.eclipse.core.runtime.CoreException;
+
+import org.eclipse.swt.widgets.Shell;
+
+import org.eclipse.jdt.ui.jarpackager.JarPackageData;
+import org.eclipse.jdt.ui.jarpackager.JarWriter3;
+
+/**
+ * @since 3.4
+ */
+public class JarWriter4 extends JarWriter3 {
+
+ private final JarPackageData fJarPackage;
+
+ public JarWriter4(JarPackageData jarPackage, Shell parent) throws CoreException {
+ super(jarPackage, parent);
+ fJarPackage= jarPackage;
+ }
+
+ public void addZipEntry(ZipEntry zipEntry, ZipFile zipFile, String path) throws IOException, CoreException {
+ JarEntry newEntry= new JarEntry(path.replace(File.separatorChar, '/'));
+
+ if (fJarPackage.isCompressed())
+ newEntry.setMethod(ZipEntry.DEFLATED);
+ // Entry is filled automatically.
+ else {
+ newEntry.setMethod(ZipEntry.STORED);
+ newEntry.setSize(zipEntry.getSize());
+ newEntry.setCompressedSize(zipEntry.getCrc());
+ }
+
+ long lastModified= System.currentTimeMillis();
+
+ // Set modification time
+ newEntry.setTime(lastModified);
+
+ addEntry(newEntry, zipFile.getInputStream(zipEntry));
+ }
+}
Index: ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarBuilder.java
===================================================================
RCS file: ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarBuilder.java
diff -N ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarBuilder.java
--- /dev/null 1 Jan 1970 00:00:00 -0000
+++ ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarBuilder.java 1 Jan 1970 00:00:00 -0000
@@ -0,0 +1,125 @@
+package org.eclipse.jdt.internal.ui.jarpackagerfat;
+
+import java.io.IOException;
+import java.util.Enumeration;
+import java.util.zip.ZipEntry;
+import java.util.zip.ZipException;
+import java.util.zip.ZipFile;
+
+import org.eclipse.core.runtime.CoreException;
+import org.eclipse.core.runtime.IPath;
+import org.eclipse.core.runtime.IProgressMonitor;
+import org.eclipse.core.runtime.MultiStatus;
+import org.eclipse.core.runtime.OperationCanceledException;
+
+import org.eclipse.core.resources.IFile;
+
+import org.eclipse.swt.widgets.Shell;
+
+import org.eclipse.jdt.internal.corext.util.Messages;
+
+import org.eclipse.jdt.ui.jarpackager.IManifestProvider;
+import org.eclipse.jdt.ui.jarpackager.JarPackageData;
+
+import org.eclipse.jdt.internal.ui.jarpackager.JarBuilder;
+
+public class FatJarBuilder extends JarBuilder {
+
+ public static final String BUILDER_ID= "org.eclipse.jdt.ui.fat_jar_builder"; //$NON-NLS-1$
+
+ private JarPackageData fJarPackage;
+ private JarWriter4 fJarWriter;
+
+ /**
+ * {@inheritDoc}
+ */
+ public String getId() {
+ return BUILDER_ID;
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public IManifestProvider getManifestProvider() {
+ return new FatJarManifestProvider(this);
+ }
+
+ public String getManifestClasspath() {
+ return "."; //$NON-NLS-1$
+ }
+
+ public boolean isMergeManifests() {
+ return true;
+ }
+
+ public boolean isRemoveSigners() {
+ return true;
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public void open(JarPackageData jarPackage, Shell displayShell, MultiStatus status) throws CoreException {
+ super.open(jarPackage, displayShell, status);
+ fJarPackage= jarPackage;
+ fJarWriter= new JarWriter4(fJarPackage, displayShell);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public void writeFile(IFile resource, IPath destinationPath) throws CoreException {
+ fJarWriter.write(resource, destinationPath);
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public void writeArchive(ZipFile jarFile, IProgressMonitor progressMonitor) {
+ Enumeration jarEntriesEnum= jarFile.entries();
+ while (jarEntriesEnum.hasMoreElements()) {
+ ZipEntry jarEntry= (ZipEntry) jarEntriesEnum.nextElement();
+ if (!jarEntry.isDirectory()) {
+ String entryName= jarEntry.getName();
+ addFile(entryName, jarEntry, jarFile);
+ }
+ progressMonitor.worked(1);
+ if (progressMonitor.isCanceled())
+ throw new OperationCanceledException();
+ }
+ }
+
+ private void addFile(String destinationPath, ZipEntry jarEntry, ZipFile zipFile) {
+ // Handle META-INF/MANIFEST.MF
+ if (destinationPath.equalsIgnoreCase("META-INF/MANIFEST.MF") //$NON-NLS-1$
+ || (isRemoveSigners() && destinationPath.startsWith("META-INF/") && destinationPath.endsWith(".SF"))) { //$NON-NLS-1$//$NON-NLS-2$
+ return;
+ }
+ try {
+ fJarWriter.addZipEntry(jarEntry, zipFile, destinationPath);
+ } catch (CoreException ex) {
+ Throwable realEx= ex.getStatus().getException();
+ if (realEx instanceof ZipException && realEx.getMessage() != null && realEx.getMessage().startsWith("duplicate entry:")) //$NON-NLS-1$
+ addWarning(ex.getMessage(), realEx);
+ else
+ addToStatus(ex);
+ } catch (IOException ex) {
+ if (ex instanceof ZipException && ex.getMessage() != null && ex.getMessage().startsWith("duplicate entry:")) {//$NON-NLS-1$
+ // ignore duplicates in META-INF (*.SF, *.RSA)
+ if (!destinationPath.startsWith("META-INF/")) { //$NON-NLS-1$
+ addWarning(ex.getMessage(), ex);
+ }
+ } else
+ addWarning(Messages.format(FatJarPackagerMessages.FatJarBuilder_error_readingArchiveFile, new Object[] { zipFile.getName(), ex.getLocalizedMessage() }), ex);
+ }
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public void close() throws CoreException {
+ if (fJarWriter != null) {
+ fJarWriter.close();
+ }
+ }
+}
Index: ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarPackageWizard.java
===================================================================
RCS file: ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarPackageWizard.java
diff -N ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarPackageWizard.java
--- /dev/null 1 Jan 1970 00:00:00 -0000
+++ ui/org/eclipse/jdt/internal/ui/jarpackagerfat/FatJarPackageWizard.java 1 Jan 1970 00:00:00 -0000
@@ -0,0 +1,241 @@
+/*******************************************************************************
+ * Copyright (c) 2007 IBM Corporation and others.
+ * All rights reserved. This program and the accompanying materials
+ * are made available under the terms of the Eclipse Public License v1.0
+ * which accompanies this distribution, and is available at
+ * http://www.eclipse.org/legal/epl-v10.html
+ *
+ * Contributors:
+ * IBM Corporation - initial API and implementation
+ *******************************************************************************/
+package org.eclipse.jdt.internal.ui.jarpackagerfat;
+
+import java.lang.reflect.InvocationTargetException;
+import java.util.HashSet;
+import java.util.Iterator;
+
+import org.eclipse.core.runtime.Assert;
+import org.eclipse.core.runtime.IStatus;
+import org.eclipse.core.runtime.MultiStatus;
+
+import org.eclipse.swt.widgets.Shell;
+
+import org.eclipse.jface.dialogs.ErrorDialog;
+import org.eclipse.jface.dialogs.IDialogConstants;
+import org.eclipse.jface.dialogs.IDialogSettings;
+import org.eclipse.jface.dialogs.MessageDialog;
+import org.eclipse.jface.viewers.ISelection;
+import org.eclipse.jface.viewers.IStructuredSelection;
+import org.eclipse.jface.viewers.StructuredSelection;
+import org.eclipse.jface.window.Window;
+import org.eclipse.jface.wizard.IWizardPage;
+import org.eclipse.jface.wizard.Wizard;
+
+import org.eclipse.ui.IExportWizard;
+import org.eclipse.ui.IWorkbench;
+
+import org.eclipse.jdt.core.IJavaElement;
+import org.eclipse.jdt.core.IJavaProject;
+import org.eclipse.jdt.core.IPackageFragmentRoot;
+
+import org.eclipse.jdt.ui.jarpackager.IJarExportRunnable;
+import org.eclipse.jdt.ui.jarpackager.JarPackageData;
+
+import org.eclipse.jdt.internal.ui.JavaPlugin;
+import org.eclipse.jdt.internal.ui.JavaPluginImages;
+import org.eclipse.jdt.internal.ui.dialogs.OptionalMessageDialog;
+import org.eclipse.jdt.internal.ui.util.ExceptionHandler;
+
+/**
+ * Wizard for exporting resources from the workspace to a Fat Java Archive (JAR) file.
+ * The exported jar will contain all required libraries.
+ *
+ * @since 3.4
+ */
+public class FatJarPackageWizard extends Wizard implements IExportWizard {
+
+ private static final class IPIssueWarningDialog extends OptionalMessageDialog {
+
+ private static final String ID= "RunnableJar.export.ipwarning"; //$NON-NLS-1$
+
+ protected IPIssueWarningDialog(Shell parent, String title, String message) {
+ super(ID, parent, title, null, message, MessageDialog.WARNING, new String[] { IDialogConstants.OK_LABEL, IDialogConstants.CANCEL_LABEL }, 0);
+ }
+
+ }
+
+ private static String DIALOG_SETTINGS_KEY= "FatJarPackageWizard"; //$NON-NLS-1$
+
+ private boolean fHasNewDialogSettings;
+ private boolean fInitializeFromJarPackage;
+ private JarPackageData fJarPackage;
+ private FatJarPackageWizardPage fJarPackageWizardPage;
+ private IStructuredSelection fSelection;
+
+ /**
+ * Creates a wizard for exporting workspace resources to a JAR file.
+ */
+ public FatJarPackageWizard() {
+ IDialogSettings workbenchSettings= JavaPlugin.getDefault().getDialogSettings();
+ IDialogSettings section= workbenchSettings.getSection(DIALOG_SETTINGS_KEY);
+ if (section == null)
+ fHasNewDialogSettings= true;
+ else {
+ fHasNewDialogSettings= false;
+ setDialogSettings(section);
+ }
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public void addPages() {
+ super.addPages();
+ fJarPackageWizardPage= new FatJarPackageWizardPage(fJarPackage, fSelection);
+ addPage(fJarPackageWizardPage);
+ }
+
+ /**
+ * Exports the JAR package.
+ *
+ * @param op the operation to run
+ * @param wizardPageStatus the status returned by the wizard page
+ * @return a boolean indicating success or failure
+ */
+ protected boolean executeExportOperation(IJarExportRunnable op, IStatus wizardPageStatus) {
+ try {
+ getContainer().run(true, true, op);
+ } catch (InterruptedException e) {
+ return false;
+ } catch (InvocationTargetException ex) {
+ if (ex.getTargetException() != null) {
+ ExceptionHandler.handle(ex, getShell(), FatJarPackagerMessages.JarPackageWizard_jarExportError_title, FatJarPackagerMessages.JarPackageWizard_jarExportError_message);
+ return false;
+ }
+ }
+ IStatus status= op.getStatus();
+ if (!status.isOK()) {
+ if (!wizardPageStatus.isOK()) {
+ if (!(status instanceof MultiStatus))
+ status= new MultiStatus(status.getPlugin(), status.getCode(), status.getMessage(), status.getException());
+
+ ((MultiStatus) status).add(wizardPageStatus);
+ }
+ ErrorDialog.openError(getShell(), FatJarPackagerMessages.JarPackageWizard_jarExport_title, null, status);
+ return !(status.matches(IStatus.ERROR));
+ } else if (!wizardPageStatus.isOK()) {
+ ErrorDialog.openError(getShell(), FatJarPackagerMessages.JarPackageWizard_jarExport_title, null, wizardPageStatus);
+ }
+ return true;
+ }
+
+ public IWizardPage getNextPage(IWizardPage page) {
+ return super.getNextPage(page);
+ }
+
+ public IWizardPage getPreviousPage(IWizardPage page) {
+ return super.getPreviousPage(page);
+ }
+
+ /**
+ * @return all java projects which contain the selected elements in the active workbench window
+ */
+ protected IStructuredSelection getSelectedJavaProjects() {
+ ISelection currentSelection= JavaPlugin.getActiveWorkbenchWindow().getSelectionService().getSelection();
+ if (currentSelection instanceof IStructuredSelection) {
+ IStructuredSelection structuredSelection= (IStructuredSelection) currentSelection;
+ HashSet selectedElements= new HashSet();
+ Iterator iter= structuredSelection.iterator();
+ while (iter.hasNext()) {
+ Object selectedElement= iter.next();
+ if (selectedElement instanceof IJavaElement) {
+ IJavaProject javaProject= ((IJavaElement) selectedElement).getJavaProject();
+ if (javaProject != null)
+ selectedElements.add(javaProject);
+ }
+ }
+ return new StructuredSelection(selectedElements);
+ } else
+ return StructuredSelection.EMPTY;
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public void init(IWorkbench workbench, IStructuredSelection selection) {
+ fSelection= getSelectedJavaProjects();
+ fJarPackage= new JarPackageData();
+ setInitializeFromJarPackage(false);
+ setWindowTitle(FatJarPackagerMessages.JarPackageWizard_windowTitle);
+ setDefaultPageImageDescriptor(JavaPluginImages.DESC_WIZBAN_FAT_JAR_PACKAGER);
+ setNeedsProgressMonitor(true);
+ }
+
+ /**
+ * Initializes this wizard from the given JAR package description.
+ *
+ * @param workbench
+ * the workbench which launched this wizard
+ * @param jarPackage
+ * the JAR package description used to initialize this wizard
+ */
+ public void init(IWorkbench workbench, JarPackageData jarPackage) {
+ Assert.isNotNull(workbench);
+ Assert.isNotNull(jarPackage);
+ fJarPackage= jarPackage;
+ setInitializeFromJarPackage(true);
+ setWindowTitle(FatJarPackagerMessages.JarPackageWizard_windowTitle);
+ setDefaultPageImageDescriptor(JavaPluginImages.DESC_WIZBAN_FAT_JAR_PACKAGER);
+ setNeedsProgressMonitor(true);
+ }
+
+ boolean isInitializingFromJarPackage() {
+ return fInitializeFromJarPackage;
+ }
+
+ /**
+ * {@inheritDoc}
+ */
+ public boolean performFinish() {
+ fJarPackage.setJarBuilder(new FatJarBuilder());
+ MultiStatus status= new MultiStatus(JavaPlugin.getPluginId(), IStatus.OK, FatJarPackagerMessages.FatJarPackageWizard_JarExportProblems_message, null);
+ Object[] elements= fJarPackageWizardPage.getSelectedElementsWithoutContainedChildren(status);
+ fJarPackage.setElements(elements);
+
+ if (OptionalMessageDialog.isDialogEnabled(IPIssueWarningDialog.ID) && hasArchive(elements)) {
+ IPIssueWarningDialog dialog= new IPIssueWarningDialog(getShell(), FatJarPackagerMessages.FatJarPackageWizard_IPIssueDialog_title,
+ FatJarPackagerMessages.FatJarPackageWizard_IPIssueDialog_message);
+ if (dialog.open() != Window.OK)
+ return false;
+ }
+
+ if (!executeExportOperation(fJarPackage.createJarExportRunnable(getShell()), status))
+ return false;
+
+ // Save the dialog settings
+ if (fHasNewDialogSettings) {
+ IDialogSettings workbenchSettings= JavaPlugin.getDefault().getDialogSettings();
+ IDialogSettings section= workbenchSettings.getSection(DIALOG_SETTINGS_KEY);
+ section= workbenchSettings.addNewSection(DIALOG_SETTINGS_KEY);
+ setDialogSettings(section);
+ }
+
+ fJarPackageWizardPage.finish();
+ return true;
+ }
+
+ private boolean hasArchive(Object[] elements) {
+ for (int i= 0; i < elements.length; i++) {
+ if (elements[i] instanceof IPackageFragmentRoot) {
+ IPackageFragmentRoot root= (IPackageFragmentRoot) elements[i];
+ if (root.isArchive())
+ return true;
+ }
+ }
+ return false;
+ }
+
+ void setInitializeFromJarPackage(boolean state) {
+ fInitializeFromJarPackage= state;
+ }
+}